Name |
Oleuropein |
Formula |
C25H32O13 |
Mw |
540.18429111 |
CAS RN |
32619-42-4 |
C_ID |
C00003093
,
|
InChIKey |
RFWGABANNQMHMZ-FBJZQJPMNA-N |
InChICode |
InChI=1S/C25H32O13/c1-3-13-14(9-19(29)35-7-6-12-4-5-16(27)17(28)8-12)15(23(33)34-2)11-36-24(13)38-25-22(32)21(31)20(30)18(10-26)37-25/h3-5,8,11,14,18,20-22,24-28,30-32H,6-7,9-10H2,1-2H3/b13-3+/t14-,18+,20+,21-,22+,24-,25-/m0/s1 |
SMILES |
[C@@H]1(/C(=C\C)/[C@@H](OC=C1C(=O)OC)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)CC(=O)OCCc1cc(c(cc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Ligusticum lucidum | Ref. |
Plantae | Oleaceae | Fraxinus americana | Ref. |
Plantae | Oleaceae | Fraxinus chinensis | Ref. |
Plantae | Oleaceae | Fraxinus excelsior L. | Ref. |
Plantae | Oleaceae | Fraxinus japonica | Ref. |
Plantae | Oleaceae | Fraxinus ornus | Ref. |
Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
Plantae | Oleaceae | Jasminum grandiflorum | Ref. |
Plantae | Oleaceae | Jasminum officinale | Ref. |
Plantae | Oleaceae | Ligustrum japonicum L. | Ref. |
Plantae | Oleaceae | Ligustrum lucidum | Ref. |
Plantae | Oleaceae | Ligustrum obtusifolium | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Oleaceae | Syringa afghanica | Ref. |
Plantae | Oleaceae | Syringa vulgaris L. | Ref. |
|
|
zoom in
Organism | Jasminum grandiflorum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|