Name |
Loganin |
Formula |
C17H26O10 |
Mw |
390.15259705 |
CAS RN |
18524-94-2 |
C_ID |
C00003088
,
|
InChIKey |
AMBQHHVBBHTQBF-FJBRCSOCNA-N |
InChICode |
InChI=1S/C17H26O10/c1-6-9(19)3-7-8(15(23)24-2)5-25-16(11(6)7)27-17-14(22)13(21)12(20)10(4-18)26-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9-,10+,11+,12+,13-,14+,16-,17-/m0/s1 |
SMILES |
[C@@H]1([C@@H]([C@H]([C@@H](O[C@@H]1CO)O[C@@H]1OC=C([C@@H]2[C@H]1[C@H]([C@H](C2)O)C)C(=O)OC)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera japonica Thunb. | Ref. |
Plantae | -- | Lonicera quinquelocularis | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Caprifoliaceae | Patrinia villosa | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus controversa | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asper | Ref. |
Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asperoides | Ref. |
Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Scabiosa japonica | Ref. |
Plantae | Gentianaceae | Centaurium erythraea | Ref. |
Plantae | Gentianaceae | Gentiana loureirii | Ref. |
Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
Plantae | Gentianaceae | Gentiana straminea | Ref. |
Plantae | Gentianaceae | Gentiana verna | Ref. |
Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
Plantae | Longaniaceae | Strychnos axillaris | Ref. |
Plantae | Longaniaceae | Strychnos ignatii | Ref. |
Plantae | Longaniaceae | Strychnos lucida | Ref. |
Plantae | Longaniaceae | Strychnos nux-vomica | Ref. |
Plantae | Longaniaceae | Strychnos spinosa | Ref. |
Plantae | Menyanthaceae | Menyanthes trifoliata | Ref. |
Plantae | Oleaceae | Jasminum grandiflorum | Ref. |
Plantae | Oleaceae | Jasminum hemsleyi Yamamoto | Ref. |
Plantae | Oleaceae | Jasminum officinale | Ref. |
Plantae | Oleaceae | Nyctanthes arbor-tristis L. | Ref. |
Plantae | Oleaceae | Osmanthus austrocaledonicus (Vieill.) Knobl. | Ref. |
Plantae | Oleaceae | Picconia excelsa (Aiton) DC. | Ref. |
Plantae | Rubiaceae | Adina racemosa | Ref. |
Plantae | Rubiaceae | Calycophyllum spruceanum | Ref. |
Plantae | Rubiaceae | Neonauclea sessilifolia | Ref. |
Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
Plantae | Rubiaceae | Sinoadina Racemosa | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
Plantae | Verbenaceae | Lippia graveolens | Ref. |
- | - | Sertia mussotii | Ref. |
|
|
zoom in
Organism | Jasminum grandiflorum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|