Name |
Aucubin |
Formula |
C15H22O9 |
Mw |
346.1263823 |
CAS RN |
479-98-1 |
C_ID |
C00003073
,
|
InChIKey |
RJWJHRPNHPHBRN-FWRYUPRZNA-N |
InChICode |
InChI=1S/C15H22O9/c16-4-6-3-8(18)7-1-2-22-14(10(6)7)24-15-13(21)12(20)11(19)9(5-17)23-15/h1-3,7-21H,4-5H2/t7-,8+,9-,10?,11+,12+,13-,14+,15+/m1/s1 |
SMILES |
[C@H]1([C@@H]([C@H]([C@@H](O[C@@H]1CO)O[C@@H]1OC=C[C@H]2[C@H]1C(=C[C@@H]2O)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Nymphalidae | Euphydryas cynthia | Ref. |
Plantae | Aucubaceae | Aucuba japonica | Ref. |
Plantae | Bignoniaceae | Catalpa ovata | Ref. |
Plantae | Eucommiaceae | Eucommia ulmoides Oliv. | Ref. |
Plantae | Globulariaceae | Globularia trichosantha | Ref. |
Plantae | Labiatae | Clerodendrum thomsonae | Ref. |
Plantae | Labiatae | Vitex agnus-castus | Ref. |
Plantae | Oleaceae | Jasminum grandiflorum | Ref. |
Plantae | Oleaceae | Jasminum officinale | Ref. |
Plantae | Orobanchaceae | Euphrasia officinalis | Ref. |
Plantae | Orobanchaceae | Odontites serotina | Ref. |
Plantae | Orobanchaceae | Pedicularis bracteosa | Ref. |
Plantae | Orobanchaceae | Pedicularis crenulata | Ref. |
Plantae | Orobanchaceae | Pedicularis groenlandica | Ref. |
Plantae | Orobanchaceae | Pedicularis lapponica | Ref. |
Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
Plantae | Orobanchaceae | Pedicularis nordmanniana | Ref. |
Plantae | Orobanchaceae | Pedicularis palustris | Ref. |
Plantae | Orobanchaceae | Pedicularis procera | Ref. |
Plantae | Orobanchaceae | Pedicularis racemosa | Ref. |
Plantae | Orobanchaceae | Rhinanthus spp. | Ref. |
Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
Plantae | Plantaginaceae | Aragoa cundinamarcensis | Ref. |
Plantae | Plantaginaceae | Erinus alpinus | Ref. |
Plantae | Plantaginaceae | Lafuentea rotundifolia | Ref. |
Plantae | Plantaginaceae | Paederota lutea | Ref. |
Plantae | Plantaginaceae | Picrorhiza scrophulariiflora | Ref. |
Plantae | Plantaginaceae | Plantago afra | Ref. |
Plantae | Plantaginaceae | Plantago alpina | Ref. |
Plantae | Plantaginaceae | Plantago altissima | Ref. |
Plantae | Plantaginaceae | Plantago amplexicaulis | Ref. |
Plantae | Plantaginaceae | Plantago arborescens | Ref. |
Plantae | Plantaginaceae | Plantago argentea | Ref. |
Plantae | Plantaginaceae | Plantago asiatica | Ref. |
Plantae | Plantaginaceae | Plantago atrata | Ref. |
Plantae | Plantaginaceae | Plantago australis | Ref. |
Plantae | Plantaginaceae | Plantago bellardi | Ref. |
Plantae | Plantaginaceae | Plantago cornuti | Ref. |
Plantae | Plantaginaceae | Plantago coronopus | Ref. |
Plantae | Plantaginaceae | Plantago cretica | Ref. |
Plantae | Plantaginaceae | Plantago depressa | Ref. |
Plantae | Plantaginaceae | Plantago hookeriana | Ref. |
Plantae | Plantaginaceae | Plantago lagopus | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Plantaginaceae | Plantago lundborgii | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Plantago maritima | Ref. |
Plantae | Plantaginaceae | Plantago media | Ref. |
Plantae | Plantaginaceae | Plantago myosuros | Ref. |
Plantae | Plantaginaceae | Plantago ovata | Ref. |
Plantae | Plantaginaceae | Plantago patagonica | Ref. |
Plantae | Plantaginaceae | Plantago raoulii | Ref. |
Plantae | Plantaginaceae | Plantago rhodosperma | Ref. |
Plantae | Plantaginaceae | Plantago sempervirens | Ref. |
Plantae | Plantaginaceae | Plantago stauntonii | Ref. |
Plantae | Plantaginaceae | Plantago subulata | Ref. |
Plantae | Plantaginaceae | Plantago uniflora | Ref. |
Plantae | Plantaginaceae | Plantago webbii | Ref. |
Plantae | Plantaginaceae | Veronica alpina | Ref. |
Plantae | Plantaginaceae | Veronica arvensis | Ref. |
Plantae | Plantaginaceae | Veronica bellidioides | Ref. |
Plantae | Plantaginaceae | Veronica cuneifolia | Ref. |
Plantae | Plantaginaceae | Veronica cymbalaria | Ref. |
Plantae | Plantaginaceae | Veronica derwentiana | Ref. |
Plantae | Plantaginaceae | Veronica hederifolia | Ref. |
Plantae | Plantaginaceae | Veronica pectinata | Ref. |
Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
Plantae | Plantaginaceae | Veronica persica | Ref. |
Plantae | Plantaginaceae | Veronica serpyllifolia | Ref. |
Plantae | Plantaginaceae | Veronica turrilliana | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rubiaceae | Morinda citrifolia | Ref. |
Plantae | Rubiaceae | Morinda officinalis | Ref. |
Plantae | Scrophulariaceae | Oreosolen wattii | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
Plantae | Scrophulariaceae | Scrophularia ilwensis | Ref. |
Plantae | Scrophulariaceae | Scrophularia lepidota | Ref. |
Plantae | Scrophulariaceae | Scrophularia ningpoensis | Ref. |
Plantae | Scrophulariaceae | Scrophularia scorodonia | Ref. |
Plantae | Scrophulariaceae | Verbascum thapsus | Ref. |
Plantae | Verbenaceae | Verbena officinalis L. | Ref. |
- | - | Vernoica cymbalaria | Ref. |
|
|
zoom in
Organism | Scrophularia ilwensis | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|