Name |
alpha-Terpinene |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
99-86-5 |
C_ID |
C00003060
,
|
InChIKey |
YHQGMYUVUMAZJR-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3 |
SMILES |
C1CC(=CC=C1C)C(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona glabra | Ref. |
Plantae | Annonaceae | Monodora myristica | Ref. |
Plantae | Annonaceae | Xylopia aethiopica | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Cicuta virosa | Ref. |
Plantae | Apiaceae | Coriandrum sativum | Ref. |
Plantae | Apiaceae | Cuminum cyminum L. | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Asteraceae | Carpesium abrotanoides | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Conyza newii | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Combretaceae | Terminalia chebula | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cupressaceae | Juniperus spp. | Ref. |
Plantae | Fabaceae | Trifolium repens L. | Ref. |
Plantae | Fagaceae | Quercus coccifera | Ref. |
Plantae | Hamamelidaceae | Liquidambar formosana | Ref. |
Plantae | Illiciaceae | Illicium anisatum | Ref. |
Plantae | Labiatae | Mentha arvensis L. | Ref. |
Plantae | Labiatae | Mentha piperita L. | Ref. |
Plantae | Labiatae | Mosla dianthera | Ref. |
Plantae | Labiatae | Ocimum americanum | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum gratissimum | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Ocimum spp. | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Tetradenia riparia | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Labiatae | Trichostema lanceolatum | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Cinnamomum parthenoxylum | Ref. |
Plantae | Lauraceae | Litsea ceylanica | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis x urophylla | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Eucalyptus spp. | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Pinaceae | Cedrus libani | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper arboreum | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Plagiochilaceae | Plagiochila standleyi | Ref. |
Plantae | Rutaceae | Atalantia guillauminii | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus grandis | Ref. |
Plantae | Rutaceae | Citrus hystrix | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Schisandraceae | Schisandra chinensis | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Verbenaceae | Lippia javanica | Ref. |
Plantae | Verbenaceae | Lippia multiflora | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Elettaria cardamomum | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Canabis sativa | Ref. |
- | - | Citrus | Ref. |
- | - | Eucalyptus | Ref. |
|
|
zoom in
Organism | Thymus maroccanus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|