Name |
alpha-Phellandrene |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
99-83-2 |
C_ID |
C00003051
,
|
InChIKey |
OGLDWXZKYODSOB-UEQNJFAPNA-N |
InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4-6,8,10H,7H2,1-3H3/t10-/m1/s1 |
SMILES |
C1=C[C@H](CC=C1C)C(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Feces) | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Pistacia lentiscus | Ref. |
Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
Plantae | Annonaceae | Annona glabra | Ref. |
Plantae | Annonaceae | Monodora myristica | Ref. |
Plantae | Annonaceae | Xylopia aethiopica | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Cuminum cyminum L. | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Ligusticum jeholense | Ref. |
Plantae | Apiaceae | Notopterygium forbesii | Ref. |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Eupatorium adenophorum | Ref. |
Plantae | Asteraceae | Petasites albus | Ref. |
Plantae | Asteraceae | Petasites hybridus | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Saussurea lappa | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cupressaceae | Juniperus spp. | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
Plantae | Fagaceae | Quercus coccifera | Ref. |
Plantae | Geraniaceae | Pelargonium graveolens | Ref. |
Plantae | Labiatae | Mentha spp. | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum gratissimum | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus eriocalyx | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Labiatae | Thymus X-porlock | Ref. |
Plantae | Lauraceae | Cinnamomum augustifolium | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Litsea cubeba | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Myrtaceae | Eucalyptus elata | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Eucalyptus microtheca | Ref. |
Plantae | Myrtaceae | Eucalyptus phellandra | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Eucalyptus spp. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Pinaceae | Pinus cembra | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus radiata | Ref. |
Plantae | Pinaceae | Pinus spp. | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Ranunculaceae | Nigella sativa L | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Atalantia guillauminii | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus medica | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Clausena excavata | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Saururaceae | Houttuynia cordata Thunb. | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Turneraceae | Turnera diffusa | Ref. |
Plantae | Verbenaceae | Lippia chevalieri | Ref. |
Plantae | Verbenaceae | Lippia multiflora | Ref. |
Plantae | Zingiberaceae | Alpinia allughas | Ref. |
Plantae | Zingiberaceae | Amomum medium | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Trachyspermum roxburghianum | Ref. |
|
|
zoom in
Organism | Turnera diffusa | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|