Name |
cis-Citral (Z)-Citral beta-Citral Neral Citral Z |
Formula |
C10H16O |
Mw |
152.12011513 |
CAS RN |
106-26-3 |
C_ID |
C00003036
,
|
InChIKey |
WTEVQBCEXWBHNA-YFHOEESVSA-N |
InChICode |
InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7- |
SMILES |
CC(C)=CCC/C(C)=C\C=O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acoraceae | Acorus calamus | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Xylopia sericea | Ref. |
Plantae | Asteraceae | Conyza newii | Ref. |
Plantae | Asteraceae | Senecio vulgaris | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Geraniaceae | Pelargonium graveolens | Ref. |
Plantae | Labiatae | Dracocephalum kotschyi | Ref. |
Plantae | Labiatae | Lavandula canarien-sis | Ref. |
Plantae | Labiatae | Melissa officinalis | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Litsea cubeba | Ref. |
Plantae | Lauraceae | Litsea verbena | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus gomphocephala | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Piperaceae | Piper cubeba | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Poaceae | Cymbopogon flexuosus | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus latifolia | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus medica | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana | Ref. |
Plantae | Solanaceae | Nicotiana tobacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Verbenaceae | Verbena triphylla | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Caffea sp. | Ref. |
|
|
zoom in
Organism | Citrus reticulata | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Saeidnia, et al., Chem Pharm Bull, 52, (2004), 1249.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
---|
|