Name |
Borneol (+/-)-Borneol |
Formula |
C10H18O |
Mw |
154.1357652 |
CAS RN |
507-70-0 |
C_ID |
C00003028
,
|
InChIKey |
DTGKSKDOIYIVQL-UHFFFAOYNA-N |
InChICode |
InChI=1S/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8-,10+/m0/s1 |
SMILES |
[C@@H]1(C[C@@H]2CC[C@]1(C2(C)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Plantae | Acanthaceae | Strobilanthes auriculatus | Ref. |
Plantae | Acoraceae | Acorus calamus | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona glabra | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Aristolochiaceae | Aristolochia heterophylla | Ref. |
Plantae | Aristolochiaceae | Aristolochia trilobata | Ref. |
Plantae | Asparagaceae | Asparagus racemosus | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Ambrosia artemisiifolia | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Conyza newii | Ref. |
Plantae | Asteraceae | Cyathocline purpurea | Ref. |
Plantae | Asteraceae | Dittrichia graveolens | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus | Ref. |
Plantae | Cistaceae | Cistus clusii | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
Plantae | Dipterocarpaceae | Dryobalanops aromatica | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Lavandula angustifolia | Ref. |
Plantae | Labiatae | Lavandula spica | Ref. |
Plantae | Labiatae | Lavandula stoechas | Ref. |
Plantae | Labiatae | Ocimum americanum | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum gratissimum | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Tetradenia riparia | Ref. |
Plantae | Labiatae | Thymus algeriensis | Ref. |
Plantae | Labiatae | Thymus broussonetii | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus caramanicus | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Myristicaceae | Myristica fragrans | Ref. |
Plantae | Myrtaceae | Eucalyptus blakelyi | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera | Ref. |
Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansi | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Verbenaceae | Lippia javanica | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza | Ref. |
Plantae | Zingiberaceae | Zingiber cassumunar Roxb. | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Lavandin abrialis | Ref. |
|
|
zoom in
Organism | Thymus maroccanus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|