Name |
Aphloiol Mangiferin 2-beta-D-Glucopyranosyl-1,3,6,7-tetrahydroxy xanthone |
Formula |
C19H18O11 |
Mw |
422.08491142 |
CAS RN |
4773-96-0 |
C_ID |
C00002962
,
|
InChIKey |
AEDDIBAIWPIIBD-JKQWEQCGNA-N |
InChICode |
InChI=1S/C19H18O11/c20-4-11-15(25)17(27)18(28)19(30-11)12-8(23)3-10-13(16(12)26)14(24)5-1-6(21)7(22)2-9(5)29-10/h1-3,11,15,17-23,25-28H,4H2/t11-,15-,17+,18-,19+/m1/s1 |
SMILES |
c1(c(c(c2c(c1)oc1c(c2=O)cc(c(c1)O)O)O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Mangifera persiciformis | Ref. |
Plantae | Anemarrhenaceae | Anemarrhena asphodeloides Bunge | Ref. |
Plantae | Aphloiaceae | Aphloia madagascariensis | Ref. |
Plantae | Aspleniaceae | Asplenium montanum Willd. | Ref. |
Plantae | Celastraceae | Salacia prinoides | Ref. |
Plantae | Davalliaceae | Davallia solida | Ref. |
Plantae | Fabaceae | Hedysarum denticulatum | Ref. |
Plantae | Fabaceae | Hedysarum sericeum | Ref. |
Plantae | Gentianaceae | Gentiana algida | Ref. |
Plantae | Gentianaceae | Gentiana campestris | Ref. |
Plantae | Gentianaceae | Gentiana lutea | Ref. |
Plantae | Gentianaceae | Gentiana rhodantha | Ref. |
Plantae | Gentianaceae | Gentiana triflora | Ref. |
Plantae | Gentianaceae | Swertia angustifolia | Ref. |
Plantae | Gentianaceae | Swertia davidii | Ref. |
Plantae | Gentianaceae | Swertia mussotii | Ref. |
Plantae | Hypericaceae | Hypericum ancherii | Ref. |
Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
Plantae | Hypericaceae | Hypericum spp. | Ref. |
Plantae | Iridaceae | Belamcanda chinensis | Ref. |
Plantae | Iridaceae | Crocus aureus | Ref. |
Plantae | Iridaceae | Crocus heuffelianus | Ref. |
Plantae | Iridaceae | Crocus laevigatus | Ref. |
Plantae | Iridaceae | Iris florentina | Ref. |
Plantae | Malpighiaceae | Hiptage madablota | Ref. |
Plantae | Malvaceae | Bombax malabaricum | Ref. |
Plantae | Malvaceae | Urena lobata | Ref. |
Plantae | Melianthaceae | Bersama engleriana Gurke | Ref. |
Plantae | Polypodiaceae | Pyrrosia calvata | Ref. |
Plantae | Polypodiaceae | Pyrrosia davidii | Ref. |
Plantae | Polypodiaceae | Pyrrosia lingua | Ref. |
Plantae | Polypodiaceae | Pyrrosia petiolosa | Ref. |
Plantae | Polypodiaceae | Pyrrosia prinoides | Ref. |
Plantae | Polypodiaceae | Pyrrosia pseudocalvata | Ref. |
Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Smilacaceae | Smilax bracteata | Ref. |
Plantae | Thymelaeaceae | Aquilaria sinensis | Ref. |
Plantae | Thymelaeaceae | Gnidia involucrata | Ref. |
Plantae | Thymelaeaceae | Phaleria macrocarpa | Ref. |
Plantae | Woodsiaceae/Dryopteridaceae | Athyrium mesosorum | Ref. |
|
|
zoom in
Organism | Gentiana lutea | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|