Name |
Rhein |
Formula |
C15H8O6 |
Mw |
284.03208799 |
CAS RN |
478-43-3 |
C_ID |
C00002861
,
|
InChIKey |
FCDLCPWAQCPTKC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H8O6/c16-9-3-1-2-7-11(9)14(19)12-8(13(7)18)4-6(15(20)21)5-10(12)17/h1-5,16-17H,(H,20,21) |
SMILES |
O=C(O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asphodelaceae | Kniphofia aloides | Ref. |
Plantae | Asteraceae | Haplopappus baylatum | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Fabaceae | Cassia acutifolia | Ref. |
Plantae | Fabaceae | Cassia alata L. | Ref. |
Plantae | Fabaceae | Cassia angustifolia | Ref. |
Plantae | Fabaceae | Cassia mimosoides | Ref. |
Plantae | Fabaceae | Cassia senna | Ref. |
Plantae | Fabaceae | Cassia tora | Ref. |
Plantae | Hemerocallidaceae | Hemerocallis fulva | Ref. |
Plantae | Hemerocallidaceae | Hemerocallis thunbergii | Ref. |
Plantae | Polygonaceae | Muehlenbeckia hastulata | Ref. |
Plantae | Polygonaceae | Muehlenbeckia tamnifolia | Ref. |
Plantae | Polygonaceae | Polygonum cuspidatum | Ref. |
Plantae | Polygonaceae | Polygonum multiflorum | Ref. |
Plantae | Polygonaceae | Rheum emodi | Ref. |
Plantae | Polygonaceae | Rheum officinale | Ref. |
Plantae | Polygonaceae | Rheum palmatum | Ref. |
Plantae | Polygonaceae | Rheum spp. | Ref. |
Plantae | Polygonaceae | Rheum tanguticum | Ref. |
Plantae | Polygonaceae | Rumex acetosa | Ref. |
Plantae | Polygonaceae | Rumex acetosella | Ref. |
Plantae | Polygonaceae | Rumex confertus | Ref. |
Plantae | Polygonaceae | Rumex crispus | Ref. |
Plantae | Polygonaceae | Rumex hydrolapathum | Ref. |
Plantae | Polygonaceae | Rumex nepalensis | Ref. |
Plantae | Polygonaceae | Rumex obtusifolius | Ref. |
Plantae | Polygonaceae | Rumex spp. | Ref. |
Plantae | Rutaceae | Ruta graveolens | Ref. |
Plantae | Scrophulariaceae | Scrophularia nodosa | Ref. |
- | - | Hemerocallus minor | Ref. |
|
|
zoom in
Organism | Rumex crispus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|