Name |
Lucidin |
Formula |
C15H10O5 |
Mw |
270.05282343 |
CAS RN |
478-08-0 |
C_ID |
C00002838
,
|
InChIKey |
AMIDUPFSOUCLQB-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O5/c16-6-10-11(17)5-9-12(15(10)20)14(19)8-4-2-1-3-7(8)13(9)18/h1-5,16-17,20H,6H2 |
SMILES |
c1ccc2c(c1)C(=O)c1c(C2=O)cc(c(c1O)CO)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Lauraceae | Lindera lucida | Ref. |
Plantae | Rubiaceae | Asperula odorata | Ref. |
Plantae | Rubiaceae | Coelospermum reticulatum | Ref. |
Plantae | Rubiaceae | Coprosma rotundifolia | Ref. |
Plantae | Rubiaceae | Galium spp. | Ref. |
Plantae | Rubiaceae | Hymenodictyon excelsum | Ref. |
Plantae | Rubiaceae | Morinda citrifolia | Ref. |
Plantae | Rubiaceae | Morinda officinalis | Ref. |
Plantae | Rubiaceae | Morinda umbellata | Ref. |
Plantae | Rubiaceae | Rubia tinctorum | Ref. |
Plantae | Rubiaceae | Rubia wallichiana DECNE | Ref. |
- | - | Commitheca liebrechtsiana | Ref. |
|
|
zoom in
Organism | Morinda officinalis | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|