Name |
Aloin Aloin A Barbaloin |
Formula |
C21H22O9 |
Mw |
418.1263823 |
CAS RN |
1415-73-2 |
C_ID |
C00002797
,
|
InChIKey |
AFHJQYHRLPMKHU-TUIPODRONA-N |
InChICode |
InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13-,14-,17+,19+,20-,21+/m1/s1 |
SMILES |
c1ccc2c(c1O)C(=O)c1c([C@@H]2[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)cc(cc1O)CO |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asphodelaceae | Aloe arborescens | Ref. |
Plantae | Asphodelaceae | Aloe barbadensis | Ref. |
Plantae | Asphodelaceae | Aloe berhana | Ref. |
Plantae | Asphodelaceae | Aloe boylei | Ref. |
Plantae | Asphodelaceae | Aloe castanea | Ref. |
Plantae | Asphodelaceae | Aloe ferox | Ref. |
Plantae | Asphodelaceae | Aloe marlothii | Ref. |
Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
Plantae | Asphodelaceae | Aloe perryi | Ref. |
Plantae | Asphodelaceae | Aloe pulcherrima | Ref. |
Plantae | Asphodelaceae | Aloe rivae | Ref. |
Plantae | Asphodelaceae | Aloe sabaea | Ref. |
Plantae | Asphodelaceae | Aloe saponaria | Ref. |
Plantae | Asphodelaceae | Aloe spp. | Ref. |
Plantae | Asphodelaceae | Aloe striata | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Polygonaceae | Rumex acetosa | Ref. |
Plantae | Polygonaceae | Rumex acetosella | Ref. |
Plantae | Polygonaceae | Rumex confertus | Ref. |
Plantae | Polygonaceae | Rumex crispus | Ref. |
Plantae | Polygonaceae | Rumex hydrolapathum | Ref. |
Plantae | Polygonaceae | Rumex obtusifolius | Ref. |
Plantae | Rhamnaceae | Rhamnus cathartica | Ref. |
Plantae | Rhamnaceae | Rhamnus frangula | Ref. |
Plantae | Rhamnaceae | Rhamnus purshiana | Ref. |
|
|
zoom in
Organism | Aloe rivae | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|