Name |
Acteoside Verbascoside Kusaginin |
Formula |
C29H36O15 |
Mw |
624.20542048 |
CAS RN |
61276-17-3 |
C_ID |
C00002783
,
|
InChIKey |
FBSKJMQYURKNSU-OQSHRHNDNA-N |
InChICode |
InChI=1S/C29H36O15/c1-13-22(36)23(37)24(38)29(41-13)44-27-25(39)28(40-9-8-15-3-6-17(32)19(34)11-15)42-20(12-30)26(27)43-21(35)7-4-14-2-5-16(31)18(33)10-14/h2-7,10-11,13,20,22-34,36-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23-,24+,25+,26+,27+,28+,29-/m0/s1 |
SMILES |
[C@@H]1([C@@H]([C@H]([C@@H](O[C@@H]1CO)OCCc1ccc(c(c1)O)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O)OC(=O)/C=C/c1cc(c(cc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
Plantae | Acanthaceae | Acanthus ilicifolius | Ref. |
Plantae | Acanthaceae | Asystasia intrusa | Ref. |
Plantae | Acanthaceae | Barleria lupulina | Ref. |
Plantae | Acanthaceae | Barleria prionitis | Ref. |
Plantae | Acanthaceae | Barleria strigosa | Ref. |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Acanthaceae | Strobilanthes cusia BREMEK | Ref. |
Plantae | Bignoniaceae | Barnettia kerrii | Ref. |
Plantae | Bignoniaceae | Dolichandrone serrulata | Ref. |
Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
Plantae | Bignoniaceae | Kigelia africana | Ref. |
Plantae | Bignoniaceae | Markhamia lutea | Ref. |
Plantae | Bignoniaceae | Markhamia stipulata | Ref. |
Plantae | Bignoniaceae | Newbouldia laevis | Ref. |
Plantae | Buddlejaceae | Buddleja cordata | Ref. |
Plantae | Buddlejaceae | Buddleja globosa | Ref. |
Plantae | Buddlejaceae | Buddleja globose | Ref. |
Plantae | Buddlejaceae | Buddleja officinalis | Ref. |
Plantae | Gesneriaceae | Aeschynanthus bracteatus | Ref. |
Plantae | Gesneriaceae | Conandron ramoidioides | Ref. |
Plantae | Gesneriaceae | Lysionotus pauciflorus | Ref. |
Plantae | Globulariaceae | Globularia davisiana | Ref. |
Plantae | Globulariaceae | Globularia trichosantha | Ref. |
Plantae | Labiatae | Callicarpa formosana | Ref. |
Plantae | Labiatae | Clerodendrum inerme | Ref. |
Plantae | Labiatae | Lamium garganicum | Ref. |
Plantae | Labiatae | Lamium purpureum L. | Ref. |
Plantae | Labiatae | Leucosceptrum japonicum | Ref. |
Plantae | Labiatae | Marrubium vulgare | Ref. |
Plantae | Labiatae | Phlomis anisodonta | Ref. |
Plantae | Labiatae | Phlomis bruguieri | Ref. |
Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
Plantae | Labiatae | Phlomis caucasica | Ref. |
Plantae | Labiatae | Phlomis grandiflora var. grandiflora | Ref. |
Plantae | Labiatae | Phlomis lanceolata | Ref. |
Plantae | Labiatae | Prostanthera melissifolia | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Stachys lanata | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Malvaceae | Firmiana platanifolia | Ref. |
Plantae | Myoporaceae | Myoporum bontioides | Ref. |
Plantae | Oleaceae | Abeliophyllum distichum Nakai | Ref. |
Plantae | Oleaceae | Fontanesia fortunei Carr. | Ref. |
Plantae | Oleaceae | Fontanesia phillyreoides Labill. | Ref. |
Plantae | Oleaceae | Forsythia japonica Makino | Ref. |
Plantae | Oleaceae | Forsythia koreana (Rehd.) Nakai | Ref. |
Plantae | Oleaceae | Forsythia spp. | Ref. |
Plantae | Oleaceae | Forsythia viridissima Lindl. | Ref. |
Plantae | Oleaceae | Fraxinus americana | Ref. |
Plantae | Oleaceae | Fraxinus americana L. | Ref. |
Plantae | Oleaceae | Fraxinus excelsior L. | Ref. |
Plantae | Oleaceae | Fraxinus griffithii C.B.Clarke | Ref. |
Plantae | Oleaceae | Fraxinus malacophylla Hemsl. | Ref. |
Plantae | Oleaceae | Fraxinus ornus L. | Ref. |
Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
Plantae | Oleaceae | Fraxinus oxycarpa Willd. | Ref. |
Plantae | Oleaceae | Fraxinus uhdei (Wenzig) Lingelsh. | Ref. |
Plantae | Oleaceae | Jasminum amplexicaule Buch.-Ham. | Ref. |
Plantae | Oleaceae | Jasminum mesnyi Hance | Ref. |
Plantae | Oleaceae | Jasminum nudiflorum | Ref. |
Plantae | Oleaceae | Jasminum polyanthum Franch. | Ref. |
Plantae | Oleaceae | Ligustrum obtusifolium Sieb.et Zucc. | Ref. |
Plantae | Oleaceae | Ligustrum robustum | Ref. |
Plantae | Oleaceae | Olea europaea L. | Ref. |
Plantae | Oleaceae | Osmanthus fragrans (Thunb.) Lour. | Ref. |
Plantae | Oleaceae | Osmanthus heterophyllus (G.Don) P.S.Green | Ref. |
Plantae | Oleaceae | Syringa reticulata (Blume) Hara | Ref. |
Plantae | Oleaceae | Syringa vulgaris L. | Ref. |
Plantae | Orobanchaceae | Cistanche deserticola | Ref. |
Plantae | Orobanchaceae | Cistanche salsa | Ref. |
Plantae | Orobanchaceae | Orobanche coerulescens | Ref. |
Plantae | Orobanchaceae | Orobanche rapum | Ref. |
Plantae | Orobanchaceae | Pedicularis condensata | Ref. |
Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
Plantae | Orobanchaceae | Pedicularis nordmanniana | Ref. |
Plantae | Orobanchaceae | Pedicularis resupinata oppositifolia | Ref. |
Plantae | Orobanchaceae | Pedicularis sibthorpii | Ref. |
Plantae | Orobanchaceae | Pedicularis wilhelmsiana | Ref. |
Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
Plantae | Pedaliaceae | Harpagophytum procumbens | Ref. |
Plantae | Plantaginaceae | Chelone obliqua | Ref. |
Plantae | Plantaginaceae | Plantago afra | Ref. |
Plantae | Plantaginaceae | Plantago alpina | Ref. |
Plantae | Plantaginaceae | Plantago altissima | Ref. |
Plantae | Plantaginaceae | Plantago arborescens | Ref. |
Plantae | Plantaginaceae | Plantago arenaria | Ref. |
Plantae | Plantaginaceae | Plantago asiatica | Ref. |
Plantae | Plantaginaceae | Plantago australis | Ref. |
Plantae | Plantaginaceae | Plantago bellardi | Ref. |
Plantae | Plantaginaceae | Plantago bellardii | Ref. |
Plantae | Plantaginaceae | Plantago cretica | Ref. |
Plantae | Plantaginaceae | Plantago hookeriana | Ref. |
Plantae | Plantaginaceae | Plantago lagopus | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Plantaginaceae | Plantago lundborgii | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Plantago myosuros | Ref. |
Plantae | Plantaginaceae | Plantago nivalis | Ref. |
Plantae | Plantaginaceae | Plantago ovata | Ref. |
Plantae | Plantaginaceae | Plantago patagonica | Ref. |
Plantae | Plantaginaceae | Plantago raoulii | Ref. |
Plantae | Plantaginaceae | Plantago sempervirens | Ref. |
Plantae | Plantaginaceae | Plantago stauntonii | Ref. |
Plantae | Plantaginaceae | Plantago subspathulata | Ref. |
Plantae | Plantaginaceae | Plantago subulata | Ref. |
Plantae | Plantaginaceae | Plantago uniflora | Ref. |
Plantae | Plantaginaceae | Plantago webbii | Ref. |
Plantae | Plantaginaceae | Sibthorpia africana L. | Ref. |
Plantae | Plantaginaceae | Sibthorpia europea L. | Ref. |
Plantae | Plantaginaceae | Veronica austriaca L. | Ref. |
Plantae | Plantaginaceae | Veronica montana | Ref. |
Plantae | Plantaginaceae | Veronica persica | Ref. |
Plantae | Plantaginaceae | Veronica polita | Ref. |
Plantae | Plantaginaceae | Veronica spuria | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Scrophulariaceae | Camptoloma lyperiiflorum (Vatke) Hillard | Ref. |
Plantae | Scrophulariaceae | Ellisiophyllum pinnatum (Wall.ex.Benth.) | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
Plantae | Scrophulariaceae | Scrophularia amplexicaulis | Ref. |
Plantae | Scrophulariaceae | Scrophularia auriculata | Ref. |
Plantae | Scrophulariaceae | Scrophularia canina | Ref. |
Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
Plantae | Scrophulariaceae | Scrophularia ningpoensis | Ref. |
Plantae | Scrophulariaceae | Scrophularia nodosa L. | Ref. |
Plantae | Scrophulariaceae | Scrophularia scopolii | Ref. |
Plantae | Scrophulariaceae | Scrophularia striata | Ref. |
Plantae | Scrophulariaceae | Verbascum mallophorum | Ref. |
Plantae | Scrophulariaceae | Verbascum phlomoides | Ref. |
Plantae | Scrophulariaceae | Verbascum sinuatum | Ref. |
Plantae | Scrophulariaceae | Verbascum wiedemannianum | Ref. |
Plantae | Verbenaceae | Lantana sp. | Ref. |
Plantae | Verbenaceae | Lippia alba | Ref. |
Plantae | Verbenaceae | Lippia dulcis TREV. | Ref. |
Plantae | Verbenaceae | Verbena bonariensis | Ref. |
Plantae | Verbenaceae | Verbena brasiliensis | Ref. |
Plantae | Verbenaceae | Verbena littoralis | Ref. |
Plantae | Verbenaceae | Verbena officinalis | Ref. |
Plantae | Verbenaceae | Verbenoxylum reitzii | Ref. |
- | - | Baphicacanthus cusia | Ref. |
- | - | Galeobdolon chinense | Ref. |
- | - | Pentemon gentianoides HBK | Ref. |
- | - | Pithecotenium crucigerum (L.) A.H Gentry | Ref. |
|
|
zoom in
Organism | Scrophularia striata | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|