Name |
Labiatenic acid Rosmarinic acid |
Formula |
C18H16O8 |
Mw |
360.08451749 |
CAS RN |
20283-92-5 |
C_ID |
C00002770
,
|
InChIKey |
DOUMFZQKYFQNTF-LBOXRDHUNA-N |
InChICode |
InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)3-6-17(23)26-16(18(24)25)9-11-2-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,24,25)/b6-3+/t16-/m1/s1 |
SMILES |
c1(c(ccc(c1)/C=C/C(=O)O[C@H](Cc1cc(c(cc1)O)O)C(=O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Anethum spp. | Ref. |
Plantae | Apiaceae | Astrantia major | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Ligusticum spp. | Ref. |
Plantae | Apiaceae | Sanicula europaea | Ref. |
Plantae | Apiaceae | Sanicula spp. | Ref. |
Plantae | Araceae | Anthurium versicolor | Ref. |
Plantae | Araceae | Colocasia esculenta | Ref. |
Plantae | Araliaceae | Centella asiatica | Ref. |
Plantae | Araliaceae | Hedera helix | Ref. |
Plantae | Boraginaceae | Lindelofia stylosa | Ref. |
Plantae | Boraginaceae | Lithospermum ruderale | Ref. |
Plantae | Boraginaceae | Symphytum officinale | Ref. |
Plantae | Chloranthaceae | Sarcandra glabra | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Momordica balsamina | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Heliotropiaceae | Tournefortia sarmentosa | Ref. |
Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
Plantae | Labiatae | Agastache rugosa | Ref. |
Plantae | Labiatae | Clinopodium chinense var. parviflorum | Ref. |
Plantae | Labiatae | Elsholtzia rugulosa Hemsl. | Ref. |
Plantae | Labiatae | Melissa officinalis | Ref. |
Plantae | Labiatae | Mentha haplocalyx | Ref. |
Plantae | Labiatae | Mentha piperita | Ref. |
Plantae | Labiatae | Nepeta cadmea | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Origanum acutidens | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Orthosiphon stamineus | Ref. |
Plantae | Labiatae | Perilla frutescens var.acuta. | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia bowleyana | Ref. |
Plantae | Labiatae | Salvia cavaleriei | Ref. |
Plantae | Labiatae | Salvia chinensis | Ref. |
Plantae | Labiatae | Salvia flava | Ref. |
Plantae | Labiatae | Salvia lavandulifolia | Ref. |
Plantae | Labiatae | Salvia miltiorrhiza | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia prionitis | Ref. |
Plantae | Labiatae | Salvia sonchifolia | Ref. |
Plantae | Labiatae | Salvia yunnanensis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Teucrium scorodonia | Ref. |
Plantae | Labiatae | Thymus austriacus | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus citriodorus | Ref. |
Plantae | Labiatae | Thymus longicaulis | Ref. |
Plantae | Labiatae | Thymus oblongifolius | Ref. |
Plantae | Labiatae | Thymus praecox | Ref. |
Plantae | Labiatae | Thymus pulegioides | Ref. |
Plantae | Labiatae | Thymus serpyllum | Ref. |
Plantae | Labiatae | Thymus sibthorpii | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lamiaceae | Coleus forskohlii | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Apeiba tibourbou | Ref. |
Plantae | Malvaceae | Helicteres angustifolia | Ref. |
Plantae | Malvaceae | Helicteres isora | Ref. |
Plantae | Malvaceae | Helicteres isora L. | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Rubiaceae | Hamelia patens | Ref. |
Plantae | Salviniaceae | Salvinia molesta | Ref. |
Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
Plantae | Verbenaceae | Verbena hybrida | Ref. |
Plantae | Zosteraceae | Zostera marina | Ref. |
Plantae | Zosteraceae | Zostera noltii | Ref. |
- | - | Robdosia coetsa | Ref. |
|
|
zoom in
Organism | Thymus austriacus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|