Name |
2-Hydroxycinnamic acid o-Coumaric acid O-coumaric acid |
Formula |
C9H8O3 |
Mw |
164.04734412 |
CAS RN |
583-17-5 |
C_ID |
C00002729
,
|
InChIKey |
PMOWTIHVNWZYFI-AATRIKPKSA-N |
InChICode |
InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5+ |
SMILES |
O=C(O)/C=C/c1ccccc1O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Ephedraceae | Ephedra nebrodensis | Ref. |
Plantae | Fabaceae | Dipteryx odorata | Ref. |
Plantae | Fabaceae | Gliricidia sepium | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Martyniaceae | Martynia annua | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Poaceae | Anthoxanthum puelii | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus mahaleb | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
|
|
zoom in
Organism | Moringa oleifera | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|