Name |
3'-Methoxy-4'-hydroxyacetophenone Acetovanillone Apocynin |
Formula |
C9H10O3 |
Mw |
166.06299419 |
CAS RN |
498-02-2 |
C_ID |
C00002689
,
|
InChIKey |
DFYRUELUNQRZTB-UHFFFAOYSA-N |
InChICode |
InChI=1S/C9H10O3/c1-6(10)7-3-4-8(11)9(5-7)12-2/h3-5,11H,1-2H3 |
SMILES |
c1cc(c(cc1C(=O)C)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apocynaceae | Apocynum androsaemifolium | Ref. |
Plantae | Apocynaceae | Apocynum cannabinum | Ref. |
Plantae | Cactaceae | Echinocereus engelmannii | Ref. |
Plantae | Cactaceae | Mammillaria runyonii | Ref. |
Plantae | Crassulaceae | Rhodiola rosea | Ref. |
Plantae | Iridaceae | Iris germanica L. | Ref. |
Plantae | Iridaceae | Iris spp. | Ref. |
Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Malvaceae | Mansonia gagei DRUMM. | Ref. |
Plantae | Paeoniaceae | Paeonia suffruticosa ANDREWS | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Plantaginaceae | Picrorhiza kurroa | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Poaceae | Zea mays L. | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rosaceae | Amelanchier alnifolia | Ref. |
Plantae | Rosaceae | Photinia davidiana | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Scrophulariaceae | Scrophularia ningpoensis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
- | - | Boophane disticha | Ref. |
|
|
zoom in
Organism | Thymus broussonetti | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|