Name |
Syringic acid Syringate 4-Hydroxy-3,5-dimethoxybenzoic acid |
Formula |
C9H10O5 |
Mw |
198.05282343 |
CAS RN |
530-57-4 |
C_ID |
C00002674
,
|
InChIKey |
JMSVCTWVEWCHDZ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) |
SMILES |
c1(cc(cc(c1O)OC)C(=O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Fungi | Hymenochaetaceae | Inonotus obliquus | Ref. |
Fungi | Hymenochaetaceae | Phellinus igniarius | Ref. |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Calendula officinalis | Ref. |
Plantae | Asteraceae | Chamomilla rectita | Ref. |
Plantae | Asteraceae | Cichorium intybus | Ref. |
Plantae | Asteraceae | Conyza canadensis | Ref. |
Plantae | Asteraceae | Conyza candensis | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Balsaminaceae | Impatiens balsamina | Ref. |
Plantae | Bignoniaceae | Catalpa ovata | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Celastraceae | Microtropis fokienensis | Ref. |
Plantae | Clusiaceae-Guttiferae | Caraipa densifolia | Ref. |
Plantae | Commelinaceae | Commelina communis | Ref. |
Plantae | Convallariaceae | Tupistra chinensis | Ref. |
Plantae | Crassulaceae | Bryophyllum pinnatum | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Isatis indigotica | Ref. |
Plantae | Cruciferae | Isatis tinctoria | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Ebenaceae | Diospyros eriantha | Ref. |
Plantae | Ericaceae | Rhododendron dauricum | Ref. |
Plantae | Ericaceae | Rhododendron micranthum | Ref. |
Plantae | Ericaceae | Rhododendron mucronatum | Ref. |
Plantae | Ericaceae | Rhododendron mucronulatum | Ref. |
Plantae | Euphorbiaceae | Cleidion spiciflorum (Burm. f.) Merr. | Ref. |
Plantae | Fabaceae | Derris scandens | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fagaceae | Quercus infectoria | Ref. |
Plantae | Hypoxidaceae | Curculigo orchioides | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Labiatae | Callicarpa integerrima | Ref. |
Plantae | Labiatae | Hyssopus officinalis | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Satureja hortensis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
Plantae | Lythraceae | Punica granatum L. | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Malvaceae | Althaea nudiflora | Ref. |
Plantae | Malvaceae | Althaea officinalis | Ref. |
Plantae | Malvaceae | Althaea rosea | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Malvaceae | Hibiscus tiliaceus | Ref. |
Plantae | Meliaceae | Trichilia emetica | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Palmae | Phoenix dactylifera | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Peperomia duclouxii C. DC. | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Plantago media | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
Plantae | Poaceae | Avena sativa | Ref. |
Plantae | Poaceae | Eleusine coracana | Ref. |
Plantae | Poaceae | Hordeum vulgare | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Panicum milliaceum | Ref. |
Plantae | Poaceae | Secale cereale | Ref. |
Plantae | Poaceae | Sorghum bicolor | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rhamnaceae | Ceanothus americanus | Ref. |
Plantae | Rhamnaceae | Colubrina faralaotra subsp.trichocarpa. | Ref. |
Plantae | Rosaceae | Mespilus germanica | Ref. |
Plantae | Rosaceae | Spiraea formosana | Ref. |
Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
Plantae | Smilacaceae | Smilax glabra | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Tamaricaceae | Tamarix gallica | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
- | - | Anisophyllea dichostyla | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Lentinula edodes | Ref. |
- | - | Scrophularis sambucifolia | Ref. |
- | - | Stenoloma chusanum | Ref. |
|
|
zoom in
Organism | Thymus capitatus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|