Name |
3,4-Dihydroxybenzoic acid Protocatechuic acid |
Formula |
C7H6O4 |
Mw |
154.02660868 |
CAS RN |
99-50-3 |
C_ID |
C00002668
,
|
InChIKey |
YQUVCSBJEUQKSH-UHFFFAOYSA-N |
InChICode |
InChI=1S/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11) |
SMILES |
c1(c(cc(cc1)C(=O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Cicadidae | Cryptotympana sp. | Ref. |
Bacteria | Pseudomonadaceae | Pseudomonas putida | Ref. |
Fungi | Hymenochaetaceae | Inonotus obliquus | Ref. |
Fungi | Hymenochaetaceae | Phellinus igniarius | Ref. |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | Actinidiaceae | Actinidia arguta | Ref. |
Plantae | Actinidiaceae | Actinidia callosa var.henryi | Ref. |
Plantae | Actinidiaceae | Actinidia chinensis | Ref. |
Plantae | Actinidiaceae | Actinidia chrysantha | Ref. |
Plantae | Actinidiaceae | Actinidia deliciosa | Ref. |
Plantae | Actinidiaceae | Actinidia eriantha | Ref. |
Plantae | Actinidiaceae | Actinidia glaucophylla | Ref. |
Plantae | Actinidiaceae | Actinidia latifolia | Ref. |
Plantae | Actinidiaceae | Actinidia polygama | Ref. |
Plantae | Actinidiaceae | Actinidia rubricaulis var.coriacea | Ref. |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Ligusticum chuanxiong | Ref. |
Plantae | Apiaceae | Ostericum koreanum | Ref. |
Plantae | Apocynaceae | Cryptolepis sinensis | Ref. |
Plantae | Aquifoliaceae | Ilex chinensis | Ref. |
Plantae | Araceae | Amorphophallus konjac K.Koch | Ref. |
Plantae | Araceae | Pinellia ternata | Ref. |
Plantae | Asphodelaceae | Aloe barbadensis | Ref. |
Plantae | Asphodelaceae | Aloe berhana | Ref. |
Plantae | Asphodelaceae | Aloe ferox | Ref. |
Plantae | Asphodelaceae | Aloe harlans | Ref. |
Plantae | Asphodelaceae | Aloe hildebrandtii | Ref. |
Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
Plantae | Asphodelaceae | Aloe pulcherrima | Ref. |
Plantae | Asphodelaceae | Aloe rivae | Ref. |
Plantae | Asteraceae | Blumea balsamifera | Ref. |
Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
Plantae | Asteraceae | Centaurea pseudoscabiosa subsp.pseudoscabiosa Boiss.et aBuhse | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Cactaceae | Opuntia dillenii HAW. | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Caryophyllales | Beta vulgaris | Ref. |
Plantae | Cbotiaceae/Dicksoniaceae | Cibotium barometz | Ref. |
Plantae | Chloranthaceae | Sarcandra glabra | Ref. |
Plantae | Combretaceae | Terminalia catappa | Ref. |
Plantae | Combretaceae | Terminalia chebula | Ref. |
Plantae | Combretaceae | Terminalia nigrovenulosa | Ref. |
Plantae | Commelinaceae | Commelina communis | Ref. |
Plantae | Crassulaceae | Hylotelephium mingjinianum | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cymodoceaceae | Amphibolis antarctica | Ref. |
Plantae | Cymodoceaceae | Amphibolis griffithii | Ref. |
Plantae | Cymodoceaceae | Cymodocea rotundata | Ref. |
Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
Plantae | Cymodoceaceae | Halodule wrightii | Ref. |
Plantae | Cymodoceaceae | Syringodium filiforme | Ref. |
Plantae | Cymodoceaceae | Syringodium isoetifolium | Ref. |
Plantae | Cymodoceaceae | Thalassodendron ciliatum | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ephedraceae | Ephedra aphylla | Ref. |
Plantae | Ephedraceae | Ephedra equisetina | Ref. |
Plantae | Ericaceae | Erica australis | Ref. |
Plantae | Ericaceae | Pyrola calliantha | Ref. |
Plantae | Eriocaulaceae | Eriocaulon buergerianum | Ref. |
Plantae | Eucommiaceae | Eucommia ulmoides Oliver | Ref. |
Plantae | Fabaceae | Acacia nilotica | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lespedeza bicolor | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
Plantae | Hydrocharitaceae | Halophila engelmannii | Ref. |
Plantae | Hydrocharitaceae | Halophila hawaiiana | Ref. |
Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
Plantae | Hypoxidaceae | Curculigo pilosa | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Orthosiphon stamineus | Ref. |
Plantae | Labiatae | Salvia bowleyana | Ref. |
Plantae | Labiatae | Salvia bulleyana | Ref. |
Plantae | Labiatae | Salvia castanea | Ref. |
Plantae | Labiatae | Salvia digitaloides | Ref. |
Plantae | Labiatae | Salvia flava | Ref. |
Plantae | Labiatae | Salvia miltiorrhiza | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia plebeia | Ref. |
Plantae | Labiatae | Salvia prionitis | Ref. |
Plantae | Labiatae | Salvia przewalskii | Ref. |
Plantae | Labiatae | Salvia sinica | Ref. |
Plantae | Labiatae | Salvia sonchifolia | Ref. |
Plantae | Labiatae | Salvia trijuga | Ref. |
Plantae | Labiatae | Salvia yunnanensis | Ref. |
Plantae | Lauraceae | Cinnamomum cassia | Ref. |
Plantae | Loranthaceae | Taxillus levinei | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Gossypium hirsutum L. | Ref. |
Plantae | Malvaceae | Hibiscus sabdariffa L. | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Meliaceae | Toona ciliata | Ref. |
Plantae | Moraceae | Brosimopsis acutifolium | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Myrtaceae | Eucalyptus grandis | Ref. |
Plantae | Myrtaceae | Eugenia edulis | Ref. |
Plantae | Myrtaceae | Myrciaria cauliflora | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Orchidaceae | Bletilla formosana | Ref. |
Plantae | Orchidaceae | Bulbophyllum vaginatum | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Palmae | Trachycarpus fortunei | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Picea ajanensis | Ref. |
Plantae | Pinaceae | Picea koraiensis | Ref. |
Plantae | Pinaceae | Picea obovata | Ref. |
Plantae | Pinaceae | Pinus roxburghii | Ref. |
Plantae | Pinaceae | Pseudolarix kaempferi Gord. | Ref. |
Plantae | Plantaginaceae | Picrorhiza kurrooa | Ref. |
Plantae | Plantaginaceae | Picrorhiza kurrosa | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Plantaginaceae | Plantago media | Ref. |
Plantae | Plantaginaceae | Veronica americana | Ref. |
Plantae | Plantaginaceae | Veronica montana | Ref. |
Plantae | Plantaginaceae | Veronica peregrina L. | Ref. |
Plantae | Plantaginaceae | Veronica polita | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Plantaginaceae | Veronica spuria | Ref. |
Plantae | Poaceae | Oryza sativa cv. Heugjinjubyeo | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Fagopyrum spp | Ref. |
Plantae | Polygonaceae | Fagopyrum spp. | Ref. |
Plantae | Polygonaceae | Polygonum cuspidatum | Ref. |
Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Ranunculaceae | Actaea racemosa | Ref. |
Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
Plantae | Rhamnaceae | Rhamnus thymifolius | Ref. |
Plantae | Rosaceae | Cowania mexicana | Ref. |
Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
Plantae | Rosaceae | Mespilus germanica | Ref. |
Plantae | Rosaceae | Rosa canina | Ref. |
Plantae | Rubiaceae | Mitragyna rotundifolia | Ref. |
Plantae | Rutaceae | Zanthoxylum piperitum | Ref. |
Plantae | Santalaceae | Viscum articulactum | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera | Ref. |
Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Typhaceae | Typha angustata | Ref. |
Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla | Ref. |
Plantae | Zosteraceae | Phyllospadix scouleri | Ref. |
Plantae | Zosteraceae | Zostera capricorni | Ref. |
Plantae | Zosteraceae | Zostera marina | Ref. |
- | - | FOOD SAKE | Ref. |
|
|
zoom in
Organism | Terminalia catappa | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|