Name |
1,3,5-Trihydroxybenzene Phloroglucinol |
Formula |
C6H6O3 |
Mw |
126.03169406 |
CAS RN |
108-73-6 |
C_ID |
C00002665
,
|
InChIKey |
QCDYQQDYXPDABM-UHFFFAOYSA-N |
InChICode |
InChI=1S/C6H6O3/c7-4-1-5(8)3-6(9)2-4/h1-3,7-9H |
SMILES |
c1(cc(cc(c1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Caryophyllaceae | Lychnis dioica | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Euphorbiaceae | Mallotus philippinensis | Ref. |
Plantae | Fabaceae | Acacia arabica | Ref. |
Plantae | Polygonaceae | Polygonum bistorta | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rosaceae | Malus pumila | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Taxodiaceae | Sequoia gigantea | Ref. |
Plantae | Taxodiaceae | Sequoia sempervirens | Ref. |
Plantae | Zingiberaceae | Alpinia blepharocalyx | Ref. |
- | - | Alliun cepa | Ref. |
- | - | Sergassum spinuligerum | Ref. |
|
|
zoom in
Organism | Polygonum bistorta | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|