Name |
1,4-Benzenediol Hydroquinone 4-Hydroxyphenol |
Formula |
C6H6O2 |
Mw |
110.03677944 |
CAS RN |
123-31-9 |
C_ID |
C00002656
,
|
InChIKey |
QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
SMILES |
Oc1ccc(O)cc1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Petroselinum spp. | Ref. |
Plantae | Apiaceae | Pimpinella anisum | Ref. |
Plantae | Asteraceae | Xanthium canadense | Ref. |
Plantae | Ericaceae | Arbutus unedo | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Fabaceae | Acacia catechu | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Orchidaceae | Gastrodia elata | Ref. |
Plantae | Pinaceae | Pinus resinosa | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Podocarpaceae | Decussocarpus wallichianus | Ref. |
Plantae | Primulaceae | Primula ovalifolia | Ref. |
Plantae | Proteaceae | Protea mellifera | Ref. |
Plantae | Rosaceae | Pyrus communis | Ref. |
Plantae | Rutaceae | Murraya euchrestifolia | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
- | - | Dysidea cf.cristagalli | Ref. |
- | - | FOOD SAKE | Ref. |
|
|
zoom in
Organism | Primula ovalifolia | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|