Name |
Gentisic acid 2,5-Dihydroxybenzoic acid |
Formula |
C7H6O4 |
Mw |
154.02660868 |
CAS RN |
490-79-9 |
C_ID |
C00002648
,
|
InChIKey |
WXTMDXOMEHJXQO-UHFFFAOYSA-N |
InChICode |
InChI=1S/C7H6O4/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,8-9H,(H,10,11) |
SMILES |
c1c(cc(c(c1)O)C(=O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Trichocomaceae | Penicillium citrinum F5 | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Asteraceae | Helianthus tuberosus | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cymodoceaceae | Cymodocea rotundata | Ref. |
Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
Plantae | Cymodoceaceae | Halodule wrightii | Ref. |
Plantae | Cymodoceaceae | Syringodium filiforme | Ref. |
Plantae | Cymodoceaceae | Syringodium isoetifolium | Ref. |
Plantae | Cymodoceaceae | Thalassodendron ciliatum | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pterocarpus santalinus | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Fumariaceae | Fumaria officinalis | Ref. |
Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
Plantae | Fumariaceae | Fumaria vaillantii | Ref. |
Plantae | Gentianaceae | Gentiana spp. | Ref. |
Plantae | Hydrocharitaceae | Halophila hawaiiana | Ref. |
Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myrtaceae | Eucalyptus grandis | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Pedaliaceae | Sesamum indicum | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Veronica officinalis | Ref. |
Plantae | Plantaginaceae | Veronica orchidea | Ref. |
Plantae | Plantaginaceae | Veronica teucrium | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Citrus cultivars | Ref. |
Plantae | Rutaceae | Citrus limonia | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zosteraceae | Phyllospadix scouleri | Ref. |
Plantae | Zosteraceae | Phyllospadix serrulatus | Ref. |
Plantae | Zosteraceae | Zostera capricorni | Ref. |
Plantae | Zosteraceae | Zostera marina | Ref. |
- | - | Sarcolaeana multiflora | Ref. |
|
|
zoom in
Organism | Scrophularia frutescens | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|