Name |
Arbutin beta-Arbutin |
Formula |
C12H16O7 |
Mw |
272.08960287 |
CAS RN |
497-76-7 |
C_ID |
C00002638
,
|
InChIKey |
BJRNKVDFDLYUGJ-MXWMHPLRNA-N |
InChICode |
InChI=1S/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
SMILES |
[C@@H]1([C@@H]([C@H]([C@@H](O[C@@H]1CO)Oc1ccc(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
Plantae | Crassulaceae | Sedum takesimense Nakai | Ref. |
Plantae | Ericaceae | Arctostaphylos uva-ursi | Ref. |
Plantae | Ericaceae | Rhododendron ferrugineum | Ref. |
Plantae | Ericaceae | Rhododendron ponticum | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Fabaceae | Onobrychis bobrovi | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Phyllanthaceae | Breynia officinalis | Ref. |
Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
Plantae | Plantaginaceae | Veronica turrilliana | Ref. |
Plantae | Rosaceae | Cotoneaster simonsii | Ref. |
Plantae | Rosaceae | Pyrus communis | Ref. |
Plantae | Salicaceae | Salix acmophylla | Ref. |
Plantae | Saxifragaceae | Bergenia crassifolia | Ref. |
Plantae | Turneraceae | Turnera diffusa | Ref. |
Plantae | Turneraceae | Turnera subulata | Ref. |
|
|
zoom in
Organism | Turnera diffusa | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|