Name |
Prunetin Prunusetin Padmakastein 5,4'-Dihydroxy-7-methoxyisoflavone |
Formula |
C16H12O5 |
Mw |
284.06847349 |
CAS RN |
552-59-0 |
C_ID |
C00002564
,
|
InChIKey |
KQMVAGISDHMXJJ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
SMILES |
c1(cc(c2c(c1)occ(c2=O)c1ccc(cc1)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Bacteria | Streptomycetaceae | Streptomyces sp. M491 | Ref. |
Plantae | Bignoniaceae | Oroxylum indicum | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Fabaceae | Dalbergia miscolobium | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dalbergia violacea | Ref. |
Plantae | Fabaceae | Genista carinalis | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Pterocarpus angolensis | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Sophora secundiflora | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Myristicaceae | Myristica malabarica | Ref. |
Plantae | Ochnaceae | Ochna calodendron | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Rosaceae | Prunus cerasus | Ref. |
Plantae | Rosaceae | Prunus puddum | Ref. |
Plantae | Rosaceae | Prunus puddun | Ref. |
Plantae | Rosaceae | Prunus spp. | Ref. |
Plantae | Rosaceae | Prunus verecunda | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
- | - | Occurs in several | Ref. |
|
|
zoom in
Organism | Genista carinalis | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
King,J.Chem.Soc.,(1952),3211
King,J.Chem.Soc.,(1952),1920 |
---|
|