Name |
Genistein 7-O-glucoside Genistin Genistoside Genistein 7-O-beta-glucopyranoside |
Formula |
C21H20O10 |
Mw |
432.10564686 |
CAS RN |
529-59-9 |
C_ID |
C00002528
,
|
InChIKey |
ZCOLJUOHXJRHDI-NXBQWJJBNA-N |
InChICode |
InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-5-13(24)16-14(6-11)29-8-12(17(16)25)9-1-3-10(23)4-2-9/h1-6,8,15,18-24,26-28H,7H2/t15-,18+,19-,20+,21+/m0/s1 |
SMILES |
O=c1c(-c2ccc(O)cc2)coc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Fabaceae | Adenocarpus complicatus | Ref. |
Plantae | Fabaceae | Baptisia bracteata | Ref. |
Plantae | Fabaceae | Baptisia cinerea | Ref. |
Plantae | Fabaceae | Baptisia lanceolata | Ref. |
Plantae | Fabaceae | Baptisia lecontei | Ref. |
Plantae | Fabaceae | Baptisia megacarpa | Ref. |
Plantae | Fabaceae | Baptisia nuttalliana | Ref. |
Plantae | Fabaceae | Cytisus baeticus | Ref. |
Plantae | Fabaceae | Cytisus eriocarpus | Ref. |
Plantae | Fabaceae | Genista aetnensis | Ref. |
Plantae | Fabaceae | Genista depressa | Ref. |
Plantae | Fabaceae | Genista ephedroides | Ref. |
Plantae | Fabaceae | Genista tinctoria | Ref. |
Plantae | Fabaceae | Genista tridentata | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Lupinus hartwegii | Ref. |
Plantae | Fabaceae | Lupinus luteus | Ref. |
Plantae | Fabaceae | Medicago littoralis | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
Plantae | Fabaceae | Pueraria tuberosa | Ref. |
Plantae | Fabaceae | Retama sphaerocarpa | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Spartium junceum | Ref. |
Plantae | Fabaceae | Thermopsis lanceolata | Ref. |
Plantae | Fabaceae | Thermopsis macrophylla | Ref. |
Plantae | Fabaceae | Thermopsis mollis | Ref. |
Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
Plantae | Fabaceae | Thermopsis villosa | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Ulex minor | Ref. |
Plantae | Fabaceae | Ulex nanus | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Moraceae | Ficus septica | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
|
|
zoom in
Organism | Adenocarpus complicatus | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Paris,Sceances Acad Sci.,257,(1963),1728 |
---|
|