Name |
Formononetin 7-Hydroxy-4'-methoxyisoflavone |
Formula |
C16H12O4 |
Mw |
268.07355887 |
CAS RN |
485-72-3 |
C_ID |
C00002525
,
|
InChIKey |
HKQYGTCOTHHOMP-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-9,17H,1H3 |
SMILES |
c1(ccc2c(c1)occ(c2=O)c1ccc(cc1)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Apiaceae | Bupleurum scorzonerifolium | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
Plantae | Euphorbiaceae | Euphorbia portlandica | Ref. |
Plantae | Fabaceae | Albizia procera | Ref. |
Plantae | Fabaceae | Amorpha fruticosa | Ref. |
Plantae | Fabaceae | Andira inermis | Ref. |
Plantae | Fabaceae | Astragalus clusii | Ref. |
Plantae | Fabaceae | Astragalus membranaceus | Ref. |
Plantae | Fabaceae | Astragalus mongholicus | Ref. |
Plantae | Fabaceae | Astragalus propinquus | Ref. |
Plantae | Fabaceae | Baptisia alba | Ref. |
Plantae | Fabaceae | Baptisia arachnifera | Ref. |
Plantae | Fabaceae | Baptisia australis | Ref. |
Plantae | Fabaceae | Baptisia bracteata | Ref. |
Plantae | Fabaceae | Baptisia calycosa | Ref. |
Plantae | Fabaceae | Baptisia cinerea | Ref. |
Plantae | Fabaceae | Baptisia lanceolata | Ref. |
Plantae | Fabaceae | Baptisia lecontei | Ref. |
Plantae | Fabaceae | Baptisia megacarpa | Ref. |
Plantae | Fabaceae | Baptisia nuttalliana | Ref. |
Plantae | Fabaceae | Baptisia perfoliata | Ref. |
Plantae | Fabaceae | Baptisia simplicifolia | Ref. |
Plantae | Fabaceae | Baptisia sphaerocarpa | Ref. |
Plantae | Fabaceae | Baptisia tinctoria | Ref. |
Plantae | Fabaceae | Caragana intermedia | Ref. |
Plantae | Fabaceae | Caragana jubata | Ref. |
Plantae | Fabaceae | Caragana microphylla | Ref. |
Plantae | Fabaceae | Castanospermum australe | Ref. |
Plantae | Fabaceae | Centrolobium robustum | Ref. |
Plantae | Fabaceae | Centrolobium sclerophyllum | Ref. |
Plantae | Fabaceae | Centrolobium tomentosum | Ref. |
Plantae | Fabaceae | Centrosema pubescens | Ref. |
Plantae | Fabaceae | Centrosema virginianum | Ref. |
Plantae | Fabaceae | Cicer anatolicum | Ref. |
Plantae | Fabaceae | Cicer arietinum | Ref. |
Plantae | Fabaceae | Cicer bijugum | Ref. |
Plantae | Fabaceae | Cicer canariensis | Ref. |
Plantae | Fabaceae | Cicer chorassanicum | Ref. |
Plantae | Fabaceae | Cicer cuneatum | Ref. |
Plantae | Fabaceae | Cicer echinospermum | Ref. |
Plantae | Fabaceae | Cicer judaicum | Ref. |
Plantae | Fabaceae | Cicer judicum | Ref. |
Plantae | Fabaceae | Cicer macracanthum | Ref. |
Plantae | Fabaceae | Cicer microphyllum | Ref. |
Plantae | Fabaceae | Cicer mogolatvicum | Ref. |
Plantae | Fabaceae | Cicer montbretii | Ref. |
Plantae | Fabaceae | Cicer nuristanicum | Ref. |
Plantae | Fabaceae | Cicer oxyodon | Ref. |
Plantae | Fabaceae | Cicer pinnatifidum | Ref. |
Plantae | Fabaceae | Cicer pungens | Ref. |
Plantae | Fabaceae | Cicer rechingeri | Ref. |
Plantae | Fabaceae | Cicer reticulatum | Ref. |
Plantae | Fabaceae | Cicer songaricum | Ref. |
Plantae | Fabaceae | Cicer yamashitae | Ref. |
Plantae | Fabaceae | Cladrastis kentukea | Ref. |
Plantae | Fabaceae | Cladrastis sikokiana | Ref. |
Plantae | Fabaceae | Cytisus proliferus | Ref. |
Plantae | Fabaceae | Dalbergia baronii | Ref. |
Plantae | Fabaceae | Dalbergia barretoana | Ref. |
Plantae | Fabaceae | Dalbergia candenatensis | Ref. |
Plantae | Fabaceae | Dalbergia cearensis | Ref. |
Plantae | Fabaceae | Dalbergia ecastophyllum | Ref. |
Plantae | Fabaceae | Dalbergia frutescens | Ref. |
Plantae | Fabaceae | Dalbergia inundata | Ref. |
Plantae | Fabaceae | Dalbergia lanceolaria | Ref. |
Plantae | Fabaceae | Dalbergia monetaria | Ref. |
Plantae | Fabaceae | Dalbergia nitidula | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dalbergia parviflora | Ref. |
Plantae | Fabaceae | Dalbergia spruceana | Ref. |
Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
Plantae | Fabaceae | Dalbergia volubilis | Ref. |
Plantae | Fabaceae | Derris oblonga | Ref. |
Plantae | Fabaceae | Diplotropis purpurea | Ref. |
Plantae | Fabaceae | Echinospartum horridum | Ref. |
Plantae | Fabaceae | Genista aetnensis | Ref. |
Plantae | Fabaceae | Genista canariensis | Ref. |
Plantae | Fabaceae | Genista nissana | Ref. |
Plantae | Fabaceae | Genista pulchella | Ref. |
Plantae | Fabaceae | Genista salzmannii | Ref. |
Plantae | Fabaceae | Genista sessilifolia | Ref. |
Plantae | Fabaceae | Genista subcapitata | Ref. |
Plantae | Fabaceae | Genista teretifolia | Ref. |
Plantae | Fabaceae | Genista tinctoria | Ref. |
Plantae | Fabaceae | Gliricidia sepium | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza echinata | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza glara | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza palidiflora | Ref. |
Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Hedysarum multijugum | Ref. |
Plantae | Fabaceae | Hedysarum polybotrys | Ref. |
Plantae | Fabaceae | Maackia amurensis | Ref. |
Plantae | Fabaceae | Maackia fauriei | Ref. |
Plantae | Fabaceae | Machaerium kuhlmannii | Ref. |
Plantae | Fabaceae | Machaerium nyctitans | Ref. |
Plantae | Fabaceae | Machaerium vestitum | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago intertexta | Ref. |
Plantae | Fabaceae | Medicago monspeliaca | Ref. |
Plantae | Fabaceae | Medicago radiata | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Melilotus italica | Ref. |
Plantae | Fabaceae | Melilotus messanensis | Ref. |
Plantae | Fabaceae | Millettia dielsiana | Ref. |
Plantae | Fabaceae | Millettia dura | Ref. |
Plantae | Fabaceae | Millettia pendula | Ref. |
Plantae | Fabaceae | Myroxylon balsamum | Ref. |
Plantae | Fabaceae | Onobrychis viciifolia | Ref. |
Plantae | Fabaceae | Ononis speciosa | Ref. |
Plantae | Fabaceae | Ononis spinosa | Ref. |
Plantae | Fabaceae | Otholobium bracteolatum | Ref. |
Plantae | Fabaceae | Otholobium sericeum | Ref. |
Plantae | Fabaceae | Otholobium uncinatum | Ref. |
Plantae | Fabaceae | Pericopsis laxiflora | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pickeringia montana | Ref. |
Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Psoralea fascicularis | Ref. |
Plantae | Fabaceae | Pterocarpus indicus | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium | Ref. |
Plantae | Fabaceae | Pterocarpus soyauxii | Ref. |
Plantae | Fabaceae | Pueraria lobata | Ref. |
Plantae | Fabaceae | Pueraria tuberosa | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Sophora secundiflora | Ref. |
Plantae | Fabaceae | Sophora tomentosa | Ref. |
Plantae | Fabaceae | Spartium junceum | Ref. |
Plantae | Fabaceae | Spatholobus suberectus | Ref. |
Plantae | Fabaceae | Swartzia polyphylla | Ref. |
Plantae | Fabaceae | Taverniera abyssinica | Ref. |
Plantae | Fabaceae | Thermopsis alterniflora | Ref. |
Plantae | Fabaceae | Thermopsis macrophylla | Ref. |
Plantae | Fabaceae | Thermopsis mollis | Ref. |
Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
Plantae | Fabaceae | Thermopsis villosa | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Fabaceae | Trifolium alpestre | Ref. |
Plantae | Fabaceae | Trifolium medium | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium pratense, | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Fabaceae | Trifolium riograndense | Ref. |
Plantae | Fabaceae | Trifolium subterraneum | Ref. |
Plantae | Fabaceae | Trifolium willdenovii | Ref. |
Plantae | Fabaceae | Trigonella anguina | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Trigonella laciniata | Ref. |
Plantae | Fabaceae | Trigonella maritima | Ref. |
Plantae | Fabaceae | Trigonella spicata | Ref. |
Plantae | Fabaceae | Ulex micranthus | Ref. |
Plantae | Fabaceae | Vatairea heteroptera | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vigna radiata | Ref. |
Plantae | Fabaceae | Virgilia oroboides | Ref. |
Plantae | Fabaceae | Wisteria brachybotrys | Ref. |
Plantae | Fabaceae | Zollernia paraensis | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Myristicaceae | Virola caducifolia | Ref. |
Plantae | Myristicaceae | Virola multinervia | Ref. |
Plantae | Myristicaceae | Virola surinamensis | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Papaveraceae | Eschscholzia californica | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
- | - | Sarcolobus globosus | Ref. |
|
|
zoom in
Organism | Trifolium riograndense | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|