Name |
Cajanin 5,2',4'-Trihydroxy-7-methoxyisoflavone |
Formula |
C16H12O6 |
Mw |
300.06338812 |
CAS RN |
32884-36-9 |
C_ID |
C00002512
,
|
InChIKey |
ALFNTRJPGFNJQV-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O6/c1-21-9-5-13(19)15-14(6-9)22-7-11(16(15)20)10-3-2-8(17)4-12(10)18/h2-7,17-19H,1H3 |
SMILES |
c1(cc(c2c(c1)occ(c2=O)c1c(cc(cc1)O)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Cyperaceae | Eriophorum scheuchzeri | Ref. |
Plantae | Fabaceae | Cajanus cajan | Ref. |
Plantae | Fabaceae | Cajanus scarabaeoides | Ref. |
Plantae | Fabaceae | Camptosema rubicundum | Ref. |
Plantae | Fabaceae | Canavalia ensiformis | Ref. |
Plantae | Fabaceae | Canavalia gladiata | Ref. |
Plantae | Fabaceae | Caragana jubata | Ref. |
Plantae | Fabaceae | Centrosema pascuorum | Ref. |
Plantae | Fabaceae | Centrosema pubescens | Ref. |
Plantae | Fabaceae | Clitoria falcata | Ref. |
Plantae | Fabaceae | Dalbergia parviflora | Ref. |
Plantae | Fabaceae | Dunbaria villosa | Ref. |
Plantae | Fabaceae | Eriosema glomeratum | Ref. |
Plantae | Fabaceae | Eriosema psoraleoides | Ref. |
Plantae | Fabaceae | Erythrina indica | Ref. |
Plantae | Fabaceae | Galactia jussiaeana | Ref. |
Plantae | Fabaceae | Rhynchosia caribaea | Ref. |
Plantae | Fabaceae | Rhynchosia densiflora | Ref. |
Plantae | Fabaceae | Rhynchosia hirsuta | Ref. |
Plantae | Fabaceae | Rhynchosia phaseoloides | Ref. |
Plantae | Fabaceae | Rhynchosia pyramidalis | Ref. |
Plantae | Fabaceae | Spatholobus suberectus | Ref. |
Plantae | Moraceae | Ficus nymphaeifolia | Ref. |
- | - | Fagelia bituminosa | Ref. |
|
|
zoom in
Organism | Centrosema pascuorum | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Z.Naturforsch.C.,31,(1976),504
Markham,Z.Naturforsch.,35,(1980),919 |
---|
|