Name |
Angelicin |
Formula |
C11H6O3 |
Mw |
186.03169406 |
CAS RN |
523-50-2 |
C_ID |
C00002450
,
|
InChIKey |
XDROKJSWHURZGO-UHFFFAOYSA-N |
InChICode |
InChI=1S/C11H6O3/c12-10-4-2-7-1-3-9-8(5-6-13-9)11(7)14-10/h1-6H |
SMILES |
c1c2c(c3c(c1)ccc(=O)o3)cco2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Angelica archangelica | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Heracleum lehmannianum | Ref. |
Plantae | Apiaceae | Heracleum spp. | Ref. |
Plantae | Apiaceae | Ligusticum multivittatum | Ref. |
Plantae | Apiaceae | Selinum vaginatum | Ref. |
Plantae | Fabaceae | Cullen drupaceum | Ref. |
Plantae | Fabaceae | Hoita macrostachya | Ref. |
Plantae | Fabaceae | Otholobium bolusii | Ref. |
Plantae | Fabaceae | Otholobium foliosum | Ref. |
Plantae | Fabaceae | Otholobium hirtum | Ref. |
Plantae | Fabaceae | Otholobium obliquum | Ref. |
Plantae | Fabaceae | Otholobium parviflorum | Ref. |
Plantae | Fabaceae | Otholobium rotundifolium | Ref. |
Plantae | Fabaceae | Otholobium sericeum | Ref. |
Plantae | Fabaceae | Otholobium stachyerum | Ref. |
Plantae | Fabaceae | Otholobium zeyheri | Ref. |
Plantae | Fabaceae | Psoralea affinis | Ref. |
Plantae | Fabaceae | Psoralea arborea | Ref. |
Plantae | Fabaceae | Psoralea cinerea | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Psoralea effusa | Ref. |
Plantae | Fabaceae | Psoralea exile | Ref. |
Plantae | Fabaceae | Psoralea fascicularis | Ref. |
Plantae | Fabaceae | Psoralea glabra | Ref. |
Plantae | Fabaceae | Psoralea lachnostachys | Ref. |
Plantae | Fabaceae | Psoralea leucantha | Ref. |
Plantae | Fabaceae | Psoralea martinii | Ref. |
Plantae | Fabaceae | Psoralea oreopolum | Ref. |
Plantae | Fabaceae | Psoralea papillosa | Ref. |
Plantae | Fabaceae | Psoralea plumosa | Ref. |
Plantae | Fabaceae | Psoralea pullata | Ref. |
Plantae | Fabaceae | Psoralea pustulata | Ref. |
Plantae | Fabaceae | Psoralea ramulosa | Ref. |
Plantae | Fabaceae | Psoralea speciosa | Ref. |
Plantae | Fagaceae | Castanopsis indica | Ref. |
Plantae | Moraceae | Ficus nitida | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Valerianaceae | Nardostachys jatamsi | Ref. |
|
|
zoom in
Organism | Aegle marmelos | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|