Name |
Pelargonin Pelargonidin 3,5-di-beta-D-glucoside |
Formula |
C27H31O15 |
Mw |
595.16629532 |
CAS RN |
17334-58-6 |
C_ID |
C00002387
,
|
InChIKey |
SLCKJKWFULXZBD-ARDLSURDNA-O |
InChICode |
InChI=1S/C27H30O15/c28-8-17-19(32)21(34)23(36)26(41-17)39-15-6-12(31)5-14-13(15)7-16(25(38-14)10-1-3-11(30)4-2-10)40-27-24(37)22(35)20(33)18(9-29)42-27/h1-7,17-24,26-29,32-37H,8-9H2,(H-,30,31)/p+1/t17-,18-,19-,20-,21+,22+,23-,24-,26-,27-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1ccc(cc1)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Ruellia spp. | Ref. |
Plantae | Balsaminaceae | Impatiens balsamina | Ref. |
Plantae | Burseraceae | Commiphora mukul | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Caryophyllaceae | Silene dioica | Ref. |
Plantae | Combretaceae | Lumnitzera littorea | Ref. |
Plantae | Convolvulaceae | Ipomoea nil | Ref. |
Plantae | Fabaceae | Erythrina suberosa | Ref. |
Plantae | Fabaceae | Lathyrus odoratus | Ref. |
Plantae | Fabaceae | Lathyrus sativus | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Saraca indica | Ref. |
Plantae | Geraniaceae | Pelargonium dolomiticum | Ref. |
Plantae | Geraniaceae | Pelargonium zonale | Ref. |
Plantae | Iridaceae | Gladiolus spp. | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Myrtaceae | Callistemon lanceolatus | Ref. |
Plantae | Nymphaeaceae | Victoria regia | Ref. |
Plantae | Onagraceae | Fuchsia spp. | Ref. |
Plantae | Orchidaceae | Broughtonia spp. | Ref. |
Plantae | Rosaceae | Rosa spp. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
|
|
zoom in
Organism | Ruellia spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann,408,(1914),42 |
---|
|