Name |
Tropine |
Formula |
C8H15NO |
Mw |
141.11536411 |
CAS RN |
120-29-6 |
C_ID |
C00002306
,
|
InChIKey |
CYHOMWAPJJPNMW-ALVKDBIINA-N |
InChICode |
InChI=1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8+ |
SMILES |
CN1C2CC[C@@H]1C[C@@H](O)C2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Convolvulaceae | Convolvulus arvensis | Ref. |
Plantae | Fumariaceae | Corydalis yanhusuo | Ref. |
Plantae | Rhizophoraceae | Crossostylis biflora | Ref. |
Plantae | Rhizophoraceae | Crossostylis multiflora | Ref. |
Plantae | Rhizophoraceae | Crossostylis sebertii | Ref. |
Plantae | Solanaceae | Anisodus acutangulus | Ref. |
Plantae | Solanaceae | Anisodus belladonna | Ref. |
Plantae | Solanaceae | Anisodus luridus | Ref. |
Plantae | Solanaceae | Anisodus tanguticus | Ref. |
Plantae | Solanaceae | Atropa baetica | Ref. |
Plantae | Solanaceae | Atropa belladonna | Ref. |
Plantae | Solanaceae | Brugmansia arborea | Ref. |
Plantae | Solanaceae | Cyphomandra betaceae | Ref. |
Plantae | Solanaceae | Datura ceratocaula | Ref. |
Plantae | Solanaceae | Datura innoxia | Ref. |
Plantae | Solanaceae | Datura metel | Ref. |
Plantae | Solanaceae | Datura stramonium x D.discolor | Ref. |
Plantae | Solanaceae | Hyoscyamus muticus | Ref. |
Plantae | Solanaceae | Hyoscyamus niger | Ref. |
Plantae | Solanaceae | Physalis peruviana | Ref. |
Plantae | Solanaceae | Physochlaina orientalis | Ref. |
Plantae | Solanaceae | Schizanthus hookeri | Ref. |
Plantae | Solanaceae | Schizanthus pinnatus | Ref. |
Plantae | Solanaceae | Scopolia carniolica | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
- | - | Salpichora origanifolia | Ref. |
|
|
zoom in
Organism | Anisodus luridus | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
---|
|