Name |
Tropine |
Formula |
C8H15NO |
Mw |
141.11536411 |
CAS RN |
120-29-6 |
C_ID |
C00002306
,
|
InChIKey |
CYHOMWAPJJPNMW-ALVKDBIINA-N |
InChICode |
InChI=1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8+ |
SMILES |
CN1C2CC[C@@H]1C[C@@H](O)C2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Convolvulaceae | Convolvulus arvensis | Ref. |
Plantae | Fumariaceae | Corydalis yanhusuo | Ref. |
Plantae | Rhizophoraceae | Crossostylis biflora | Ref. |
Plantae | Rhizophoraceae | Crossostylis multiflora | Ref. |
Plantae | Rhizophoraceae | Crossostylis sebertii | Ref. |
Plantae | Solanaceae | Anisodus acutangulus | Ref. |
Plantae | Solanaceae | Anisodus belladonna | Ref. |
Plantae | Solanaceae | Anisodus luridus | Ref. |
Plantae | Solanaceae | Anisodus tanguticus | Ref. |
Plantae | Solanaceae | Atropa baetica | Ref. |
Plantae | Solanaceae | Atropa belladonna | Ref. |
Plantae | Solanaceae | Brugmansia arborea | Ref. |
Plantae | Solanaceae | Cyphomandra betaceae | Ref. |
Plantae | Solanaceae | Datura ceratocaula | Ref. |
Plantae | Solanaceae | Datura innoxia | Ref. |
Plantae | Solanaceae | Datura metel | Ref. |
Plantae | Solanaceae | Datura stramonium x D.discolor | Ref. |
Plantae | Solanaceae | Hyoscyamus muticus | Ref. |
Plantae | Solanaceae | Hyoscyamus niger | Ref. |
Plantae | Solanaceae | Physalis peruviana | Ref. |
Plantae | Solanaceae | Physochlaina orientalis | Ref. |
Plantae | Solanaceae | Schizanthus hookeri | Ref. |
Plantae | Solanaceae | Schizanthus pinnatus | Ref. |
Plantae | Solanaceae | Scopolia carniolica | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
- | - | Salpichora origanifolia | Ref. |
|
|
zoom in
Organism | Datura ceratocaula | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|