Name |
Apohyoscine Aposcopolamine |
Formula |
C17H19NO3 |
Mw |
285.13649348 |
CAS RN |
535-26-2 |
C_ID |
C00002276
,
|
InChIKey |
JJNVDCBKBUSUII-PTWVKLKZNA-N |
InChICode |
InChI=1S/C17H19NO3/c1-10(11-6-4-3-5-7-11)17(19)20-12-8-13-15-16(21-15)14(9-12)18(13)2/h3-7,12-16H,1,8-9H2,2H3/t12-,13-,14+,15-,16+ |
SMILES |
N1([C@@H]2C[C@H](C[C@H]1[C@H]1[C@@H]2O1)OC(=O)C(=C)c1ccccc1)C |
Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp L-Phe |
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Solanaceae | Atropa baetica | Ref. |
Plantae | Solanaceae | Datura ceratocaula | Ref. |
Plantae | Solanaceae | Datura meteloides | Ref. |
Plantae | Solanaceae | Datura stramonium x D.discolor | Ref. |
Plantae | Solanaceae | Duboisia myoporoides | Ref. |
Plantae | Solanaceae | Hyoscyamus albus | Ref. |
Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
Plantae | Solanaceae | Hyoscyamus muticus | Ref. |
Plantae | Solanaceae | Hyoscyamus niger | Ref. |
Plantae | Solanaceae | Mandragora turcomanica Mizger | Ref. |
Plantae | Solanaceae | Physochlaina alaica | Ref. |
|
|
zoom in
Organism | Datura ceratocaula | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|