Name |
Solanidine |
Formula |
C27H43NO |
Mw |
397.334465 |
CAS RN |
80-78-4 |
C_ID |
C00002261
,
|
InChIKey |
JVKYZPBMZPJNAJ-PQBWWHDJNA-N |
InChICode |
InChI=1S/C27H43NO/c1-16-5-8-23-17(2)25-24(28(23)15-16)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h6,16-17,19-25,29H,5,7-15H2,1-4H3/t16-,17+,19-,20+,21-,22-,23-,24-,25-,26-,27-/m0/s1 |
SMILES |
C[C@H]1CC[C@H]2[C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@@H](O)CC[C@]6(C)[C@H]5CC[C@]34C)N2C1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Liliaceae | Fritillaria camtschatcensis | Ref. |
Plantae | Liliaceae | Fritillaria cirrhosa | Ref. |
Plantae | Liliaceae | Fritillaria tortifolia | Ref. |
Plantae | Liliaceae | Fritillaria ussuriensis | Ref. |
Plantae | Liliaceae | Fritillaria verticillata var.thunbergii | Ref. |
Plantae | Melanthiaceae | Veratrum grandiflorum | Ref. |
Plantae | Melanthiaceae | Veratrum mentzeanum | Ref. |
Plantae | Melanthiaceae | Veratrum nigrum | Ref. |
Plantae | Melanthiaceae | Veratrum taliense | Ref. |
Plantae | Solanaceae | Capsicum frutescens | Ref. |
Plantae | Solanaceae | Solanum americanum | Ref. |
Plantae | Solanaceae | Solanum chacoense | Ref. |
Plantae | Solanaceae | Solanum chenopodioides | Ref. |
Plantae | Solanaceae | Solanum nigrum | Ref. |
Plantae | Solanaceae | Solanum spp. | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Solanaceae | Solanum villosum | Ref. |
Plantae | Solanaceae | Solanum xanthocarpum | Ref. |
|
|
zoom in
Organism | Solanum chenopodioides | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|