Name |
Sanguinarine Pseudochelerythrine Sanguinarin Sanguinarium |
Formula |
C20H14NO4 |
Mw |
332.09228294 |
CAS RN |
2447-54-3 |
C_ID |
C00001917
, 
|
InChIKey |
INVGWHRKADIJHF-UHFFFAOYSA-N |
InChICode |
InChI=1S/C20H14NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-8H,9-10H2,1H3/q+1 |
SMILES |
c1cc2c(c3c1c1c([n+](c3)C)c3c(cc1)cc1c(c3)OCO1)OCO2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Fumariaceae | Corydalis cava  | Ref. |
Plantae | Fumariaceae | Corydalis gigantea Trautv.et Mey | Ref. |
Plantae | Fumariaceae | Corydalis incisa | Ref. |
Plantae | Fumariaceae | Corydalis ledebouriana K.et K. | Ref. |
Plantae | Fumariaceae | Corydalis marshalliana pers. | Ref. |
Plantae | Fumariaceae | Corydalis ophiocarpa Hook.Et Thoms. | Ref. |
Plantae | Fumariaceae | Corydalis pallida | Ref. |
Plantae | Fumariaceae | Corydalis paniculugera Rgl. | Ref. |
Plantae | Fumariaceae | Corydalis pseudoadunca | Ref. |
Plantae | Fumariaceae | Corydalis remota Fisch. | Ref. |
Plantae | Fumariaceae | Corydalis rosea Leych. | Ref. |
Plantae | Fumariaceae | Corydalis sewerzovii | Ref. |
Plantae | Fumariaceae | Corydalis stricta Steph. | Ref. |
Plantae | Fumariaceae | Corydalis vaginans Royle | Ref. |
Plantae | Fumariaceae | Dicentra peregrina | Ref. |
Plantae | Fumariaceae | Dicentra spectabilis | Ref. |
Plantae | Fumariaceae | Dicentra spectabilis L. | Ref. |
Plantae | Fumariaceae | Fumaria asepala  | Ref. |
Plantae | Fumariaceae | Fumaria bella | Ref. |
Plantae | Fumariaceae | Fumaria cilicica | Ref. |
Plantae | Fumariaceae | Fumaria kralikii | Ref. |
Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
Plantae | Fumariaceae | Fumaria parviflora Lam  | Ref. |
Plantae | Fumariaceae | Fumaria schramii Pugsley | Ref. |
Plantae | Fumariaceae | Hypecoum leptocarpum  | Ref. |
Plantae | Fumariaceae | Hypecoum trilobum | Ref. |
Plantae | Moraceae | Morus alba  | Ref. |
Plantae | Papaveraceae | Argemone mexicana  | Ref. |
Plantae | Papaveraceae | Argemone subfusiformia | Ref. |
Plantae | Papaveraceae | Bocconia frutescens | Ref. |
Plantae | Papaveraceae | Chelidonium japonicum Thumb. | Ref. |
Plantae | Papaveraceae | Chelidonium majus  | Ref. |
Plantae | Papaveraceae | Chelidonium majus L.  | Ref. |
Plantae | Papaveraceae | Dicranostigma franchetianum Fedde | Ref. |
Plantae | Papaveraceae | Dicranostigma lactucoides  | Ref. |
Plantae | Papaveraceae | Dicranostigma lactucoides Hook.et Thoms.  | Ref. |
Plantae | Papaveraceae | Dicranostigma leptopodum Fedde | Ref. |
Plantae | Papaveraceae | Eschscholtzia california | Ref. |
Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
Plantae | Papaveraceae | Glaucium fimbrilligerum Boiss. | Ref. |
Plantae | Papaveraceae | Glaucium flavum  | Ref. |
Plantae | Papaveraceae | Glaucium grandiflorum | Ref. |
Plantae | Papaveraceae | Glaucium squamigerum Kar.et KIR. | Ref. |
Plantae | Papaveraceae | Hylomecon japonica | Ref. |
Plantae | Papaveraceae | Macleaya cordata  | Ref. |
Plantae | Papaveraceae | Macleaya microcarpa | Ref. |
Plantae | Papaveraceae | Papaver bracteatum  | Ref. |
Plantae | Papaveraceae | Papaver commutatum | Ref. |
Plantae | Papaveraceae | Papaver radicatum | Ref. |
Plantae | Papaveraceae | Papaver somniferum  | Ref. |
Plantae | Papaveraceae | Sanguinaria canadensis  | Ref. |
Plantae | Papaveraceae | Stylophorum lasiocarpum | Ref. |
Plantae | Pteridophyllaceae | Pteridophyllum racemosum Sieb.et Zuce. | Ref. |
Plantae | Pteridophyllaceae | Pteridophyllum spp. | Ref. |
Plantae | Ranunculaceae | Coptis japonica  | Ref. |
Plantae | Rutaceae | Zanthoxylum spp. | Ref. |
|
|
zoom in
Organism | Fumaria asepala | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|