Name |
Salutaridine (+)-Salutaridine |
Formula |
C19H21NO4 |
Mw |
327.14705817 |
CAS RN |
1936-18-1 |
C_ID |
C00001916
,
|
InChIKey |
GVTRUVGBZQJVTF-KINVLMLONA-N |
InChICode |
InChI=1S/C19H21NO4/c1-20-7-6-19-10-16(24-3)14(21)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9-10,13,22H,6-8H2,1-3H3/t13-,19+/m1/s1 |
SMILES |
c1(c2c(ccc1OC)C[C@@H]1C3=CC(=O)C(=C[C@]23CCN1C)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Artabotrys uncinatus | Ref. |
Plantae | Apocynaceae | Alstonia scholaris | Ref. |
Plantae | Euphorbiaceae | Croton balsamifera | Ref. |
Plantae | Euphorbiaceae | Croton hemiargyreus | Ref. |
Plantae | Euphorbiaceae | Croton salutaris | Ref. |
Plantae | Fumariaceae | Sarcocapnos saetabensis | Ref. |
Plantae | Menispermaceae | Antizoma angustifolia | Ref. |
Plantae | Papaveraceae | Glaucium fimbrilligerum | Ref. |
Plantae | Papaveraceae | Papaver bracteatum | Ref. |
Plantae | Papaveraceae | Papaver caucasicum | Ref. |
Plantae | Papaveraceae | Papaver fugax | Ref. |
Plantae | Papaveraceae | Papaver lasiothrix | Ref. |
Plantae | Papaveraceae | Papaver orientale | Ref. |
Plantae | Papaveraceae | Papaver somniferum | Ref. |
Plantae | Papaveraceae | Papaver triniifolium | Ref. |
|
|
zoom in
Organism | Papaver lasiothrix | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|