| Name |
Obaberine |
| Formula |
C38H42N2O6 |
| Mw |
622.30428709 |
| CAS RN |
1263-80-5 |
| C_ID |
C00001895
, 
|
| InChIKey |
FBCXFKWMGIWMJQ-SPFVONBBNA-N |
| InChICode |
InChI=1S/C38H42N2O6/c1-39-15-13-25-20-32(42-4)34-22-28(25)29(39)18-24-9-12-31(41-3)33(19-24)45-27-10-7-23(8-11-27)17-30-36-26(14-16-40(30)2)21-35(43-5)37(44-6)38(36)46-34/h7-12,19-22,29-30H,13-18H2,1-6H3/t29-,30+/m1/s1 |
| SMILES |
COc1ccc2cc1Oc1ccc(cc1)C[C@H]1c3c(cc(OC)c(OC)c3Oc3cc4c(cc3OC)CCN(C)[C@@H]4C2)CCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Berberis baluchistanica | Ref. |
| Plantae | Berberidaceae | Berberis heterobotrys | Ref. |
| Plantae | Berberidaceae | Berberis spp. | Ref. |
| Plantae | Berberidaceae | Berberis tschonoskiana | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris  | Ref. |
| Plantae | Berberidaceae | Mahonia repens | Ref. |
| Plantae | Lauraceae | Dehaasia triandra | Ref. |
| Plantae | Menispermaceae | Albertisia papuana | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha | Ref. |
| Plantae | Menispermaceae | Stephania erecta | Ref. |
| Plantae | Ranunculaceae | Thalictrum incidum | Ref. |
| Plantae | Ranunculaceae | Thalictrum lucidum | Ref. |
| Plantae | Ranunculaceae | Thalictrum minus | Ref. |
|
|
zoom in
| Organism | Thalictrum incidum |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
