Name |
(S)-Isoboldine Isoboldine (+)-Isoboldine |
Formula |
C19H21NO4 |
Mw |
327.14705817 |
CAS RN |
3019-51-0 |
C_ID |
C00001869
,
|
InChIKey |
LINHZVMHXABQLB-UGPWUYPHNA-N |
InChICode |
InChI=1S/C19H21NO4/c1-20-5-4-10-8-16(24-3)19(22)18-12-9-15(23-2)14(21)7-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m0/s1 |
SMILES |
c1(c2c3c(cc1OC)CCN([C@H]3Cc1c2cc(c(c1)O)OC)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Annona cherimolia | Ref. |
Plantae | Annonaceae | Annona senegalensis | Ref. |
Plantae | Annonaceae | Anomianthus dulcis | Ref. |
Plantae | Annonaceae | Anonna salzmanii | Ref. |
Plantae | Annonaceae | Cardiopetalum calophyllum | Ref. |
Plantae | Annonaceae | Guatteria goudotiana | Ref. |
Plantae | Annonaceae | Xylopia danguyella | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Annonaceae | Xylopia vieillardi | Ref. |
Plantae | Berberidaceae | Berberis brandisiana | Ref. |
Plantae | Berberidaceae | Nandina domestica | Ref. |
Plantae | Cupressaceae | Thuja orientalis | Ref. |
Plantae | Euphorbiaceae | Croton celtidifolius | Ref. |
Plantae | Euphorbiaceae | Croton lechleri Mull.Arg. | Ref. |
Plantae | Fabaceae | Erythrina abyssinica | Ref. |
Plantae | Fabaceae | Erythrina poeppigiana | Ref. |
Plantae | Fumariaceae | Ceratocapnos palaestinus | Ref. |
Plantae | Fumariaceae | Corydalis bungeana | Ref. |
Plantae | Fumariaceae | Corydalis caucasia | Ref. |
Plantae | Fumariaceae | Corydalis cava | Ref. |
Plantae | Fumariaceae | Corydalis gortschakovii | Ref. |
Plantae | Fumariaceae | Corydalis intermedia | Ref. |
Plantae | Fumariaceae | Corydalis nobilis | Ref. |
Plantae | Fumariaceae | Corydalis solida | Ref. |
Plantae | Fumariaceae | Fumaria agraria | Ref. |
Plantae | Fumariaceae | Fumaria bella | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Lauraceae | Aniba canelilla | Ref. |
Plantae | Lauraceae | Cassytha filiformis | Ref. |
Plantae | Lauraceae | Cryptocarya chinensis | Ref. |
Plantae | Lauraceae | Dehaasia triandra | Ref. |
Plantae | Lauraceae | Lindera glauca | Ref. |
Plantae | Lauraceae | Litsea acuminata | Ref. |
Plantae | Lauraceae | Litsea cubeba | Ref. |
Plantae | Lauraceae | Litsea glutinosa | Ref. |
Plantae | Lauraceae | Nectandra grandiflora | Ref. |
Plantae | Lauraceae | Nectandra membranacea | Ref. |
Plantae | Lauraceae | Nectandra salicifolia | Ref. |
Plantae | Lauraceae | Neolitsea konishii | Ref. |
Plantae | Lauraceae | Ocotea caesia | Ref. |
Plantae | Lauraceae | Phoebe minutiflora | Ref. |
Plantae | Menispermaceae | Cocculus laurifolius | Ref. |
Plantae | Menispermaceae | Pachygone dasycarpa | Ref. |
Plantae | Menispermaceae | Stephania cepharantha | Ref. |
Plantae | Menispermaceae | Stephania excentrica | Ref. |
Plantae | Menispermaceae | Stephania officinarum | Ref. |
Plantae | Monimiaceae | Peumus boldus | Ref. |
Plantae | Papaveraceae | Glaucium arabicum | Ref. |
Plantae | Papaveraceae | Glaucium flavum | Ref. |
Plantae | Papaveraceae | Glaucium grandiflorum | Ref. |
Plantae | Papaveraceae | Papaver orientale | Ref. |
Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
Plantae | Papaveraceae | Papaver rhoeas | Ref. |
Plantae | Papaveraceae | Papaver setigerum | Ref. |
Plantae | Papaveraceae | Stylophorum lasiocarpum | Ref. |
Plantae | Ranunculaceae | Aconitum karacolicum | Ref. |
Plantae | Ranunculaceae | Aconitum saposhnikovii | Ref. |
Plantae | Ranunculaceae | Thalictrum collinum | Ref. |
Plantae | Ranunculaceae | Thalictrum foetidum | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
|
|
zoom in
Organism | Fumaria bella | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|