Name |
Naphthalene |
Formula |
C10H8 |
Mw |
128.06260026 |
CAS RN |
91-20-3 |
C_ID |
C00001259
, 
|
InChIKey |
UFWIBTONFRDIAS-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
SMILES |
c1cccc2c1cccc2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Apiaceae | Saposhnikovia divaricata | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Caricaceae | Carica papaya  | Ref. |
Plantae | Herbertaceae | Herbertus sakuraii | Ref. |
Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
Plantae | Magnoliaceae | Magnolia praecocissima  | Ref. |
Plantae | Magnoliaceae | Magnolia tomentosa | Ref. |
Plantae | Rosaceae | Prunus armeniaca L. (K604-19,K113-40,K33-81)  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Rosaceae | Prunus salcina Lindl. (Blackamber,Friar) | Ref. |
Plantae | Rutaceae | Ruta graveolens  | Ref. |
Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
- | - | Microcystis aeruginosa | Ref. |
|
|
zoom in
Organism | Saposhnikovia divaricata | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
---|
|