Name |
Oleic acid (Z)-9-Octadecenoic acid |
Formula |
C18H34O2 |
Mw |
282.25588033 |
CAS RN |
112-80-1 |
C_ID |
C00001232
,
|
InChIKey |
ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
InChICode |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
SMILES |
CCCCCCCC/C=C\CCCCCCCC(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Plantae | Acanthaceae | Justicia heterocarpa T.ANDERS | Ref. |
Plantae | Alliaceae | Allium hirtifolium | Ref. |
Plantae | Amaranthaceae | Celosia cristada | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Apiaceae | Daucus carota subsp. Sativus | Ref. |
Plantae | Apiaceae | Ferula assa-foetida | Ref. |
Plantae | Apiaceae | Notopterygium incisum | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Combretaceae | Terminalia chebula | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Isatis tinctoria | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Euphorbiaceae | Jatropha curcus | Ref. |
Plantae | Fabaceae | Bauhinia tomentosa | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Iridaceae | Iris soforana | Ref. |
Plantae | Jubulaceae | Frullania incumbens | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Laminariaceae | Laminaria japonica | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Linaceae | Linum scabrellum | Ref. |
Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
Plantae | Lythraceae | Lagerstroemia thomsonil | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Malvaceae | Tilia cordata Mill. | Ref. |
Plantae | Meliaceae | Aphanamixis polystachya | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Pandanaceae | Pandanus conoideus Lam | Ref. |
Plantae | Pedaliaceae | Sesamum indicum | Ref. |
Plantae | Pedaliaceae | Sesamum orientale | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Ranunculaceae | Nigella sativa L | Ref. |
Plantae | Rosaceae | Potentilla asiatica | Ref. |
Plantae | Rosaceae | Potentilla desertorum | Ref. |
Plantae | Rosaceae | Potentilla orientalis | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera Meerb. | Ref. |
Plantae | Simaroubaceae | Brucea javanica | Ref. |
Plantae | Solanaceae | Datura innoxial | Ref. |
Plantae | Solanaceae | Datura metel | Ref. |
Plantae | Solanaceae | Hyoscyamus niger | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
- | - | Curcurbita pepo L. | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Poterium polygamum | Ref. |
- | - | Scurrura atropurpurea | Ref. |
- | - | Sebastiana sebiferum | Ref. |
|
|
zoom in
Organism | Hyoscyamus niger | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., CCMM, 19, (1994), 99.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
OHASHI, et al., Chem Pharm Bull, 51, (2003), 343.
Morikawa, et al., JNP, 65, (2002), 1468.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|