Name |
Oleic acid (Z)-9-Octadecenoic acid |
Formula |
C18H34O2 |
Mw |
282.25588033 |
CAS RN |
112-80-1 |
C_ID |
C00001232
,
|
InChIKey |
ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
InChICode |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
SMILES |
CCCCCCCC/C=C\CCCCCCCC(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Plantae | Acanthaceae | Justicia heterocarpa T.ANDERS | Ref. |
Plantae | Alliaceae | Allium hirtifolium | Ref. |
Plantae | Amaranthaceae | Celosia cristada | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Apiaceae | Daucus carota subsp. Sativus | Ref. |
Plantae | Apiaceae | Ferula assa-foetida | Ref. |
Plantae | Apiaceae | Notopterygium incisum | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Combretaceae | Terminalia chebula | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Isatis tinctoria | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Euphorbiaceae | Jatropha curcus | Ref. |
Plantae | Fabaceae | Bauhinia tomentosa | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Iridaceae | Iris soforana | Ref. |
Plantae | Jubulaceae | Frullania incumbens | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Laminariaceae | Laminaria japonica | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Linaceae | Linum scabrellum | Ref. |
Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
Plantae | Lythraceae | Lagerstroemia thomsonil | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Malvaceae | Tilia cordata Mill. | Ref. |
Plantae | Meliaceae | Aphanamixis polystachya | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Pandanaceae | Pandanus conoideus Lam | Ref. |
Plantae | Pedaliaceae | Sesamum indicum | Ref. |
Plantae | Pedaliaceae | Sesamum orientale | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Ranunculaceae | Nigella sativa L | Ref. |
Plantae | Rosaceae | Potentilla asiatica | Ref. |
Plantae | Rosaceae | Potentilla desertorum | Ref. |
Plantae | Rosaceae | Potentilla orientalis | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera Meerb. | Ref. |
Plantae | Simaroubaceae | Brucea javanica | Ref. |
Plantae | Solanaceae | Datura innoxial | Ref. |
Plantae | Solanaceae | Datura metel | Ref. |
Plantae | Solanaceae | Hyoscyamus niger | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
- | - | Curcurbita pepo L. | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Poterium polygamum | Ref. |
- | - | Scurrura atropurpurea | Ref. |
- | - | Sebastiana sebiferum | Ref. |
|
|
zoom in
Organism | Aegle marmelos | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|