Name |
Linoleic acid (Z,Z)-9,12-Octadecadienoic acid |
Formula |
C18H32O2 |
Mw |
280.24023027 |
CAS RN |
60-33-3 |
C_ID |
C00001224
,
|
InChIKey |
OYHQOLUKZRVURQ-IXWMQOLASA-N |
InChICode |
InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6-,10-9+ |
SMILES |
C(=C\C/C=C/CCCCCCCC(=O)O)\CCCCC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Fungi | Elaphomycetaceae | Monascus pilosus BCRC38072 | Ref. |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Fungi | Trichocomaceae | Aspergillus insuetus | Ref. |
Plantae | Acanthaceae | Justicia heterocarpa T.ANDERS | Ref. |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Alliaceae | Allium hirtifolium | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota subsp. Sativus | Ref. |
Plantae | Aquifoliaceae | Ilex integra | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Silybum marianum | Ref. |
Plantae | Boraginaceae | Echium auberianum | Ref. |
Plantae | Boraginaceae | Echium boissieri | Ref. |
Plantae | Boraginaceae | Echium gentianoides | Ref. |
Plantae | Boraginaceae | Echium giganteum | Ref. |
Plantae | Boraginaceae | Echium lusitanicum | Ref. |
Plantae | Boraginaceae | Echium pitardii | Ref. |
Plantae | Boraginaceae | Echium plantagineum | Ref. |
Plantae | Boraginaceae | Echium sabulicola | Ref. |
Plantae | Boraginaceae | Echium strictum | Ref. |
Plantae | Boraginaceae | Echium vulgare | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cruciferae | Isatis tinctoria | Ref. |
Plantae | Cruciferae | Lepidium meyenii Maca | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Euphorbiaceae | Aleurites moluccana | Ref. |
Plantae | Euphorbiaceae | Aleurites montana | Ref. |
Plantae | Euphorbiaceae | Jatropha curcus | Ref. |
Plantae | Fabaceae | Acacia mellifera | Ref. |
Plantae | Fabaceae | Bauhinia tomentosa | Ref. |
Plantae | Fabaceae | Cassia absu | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Iridaceae | Iris soforana | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Laminariaceae | Laminaria japonica | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lythraceae | Lagerstroemia thomsonil | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Malvaceae | Durio zibethinus | Ref. |
Plantae | Malvaceae | Tilia cordata Mill. | Ref. |
Plantae | Meliaceae | Aphanamixis polystachya | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Oleaceae | Jasminum auriculatum | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Ranunculaceae | Nigella sativa | Ref. |
Plantae | Rosaceae | Potentilla asiatica | Ref. |
Plantae | Rosaceae | Potentilla desertorum | Ref. |
Plantae | Rosaceae | Potentilla orientalis | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Ruta graveolens | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum L. | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera Meerb. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Typhaceae | Typha domingensis P. | Ref. |
Plantae | Urticaceae | Boehmeria holosericea | Ref. |
Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Chamaemalum nobile | Ref. |
- | - | Curcurbita pepo L. | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Poterium polygamum | Ref. |
- | - | Sebastiana sebiferum | Ref. |
- | - | Spongiporus leucomallellus (Murril) | Ref. |
|
|
zoom in
Organism | Curcuma longa | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|