Name |
Behenic acid |
Formula |
C22H44O2 |
Mw |
340.33413065 |
CAS RN |
112-85-6 |
C_ID |
C00001211
, 
|
InChIKey |
UKMSUNONTOPOIO-UHFFFAOYSA-N |
InChICode |
InChI=1S/C22H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2-21H2,1H3,(H,23,24) |
SMILES |
CCCCCCCCCCCCCCCCCCCCCC(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Annonaceae | Annona squamosa  | Ref. |
Plantae | Asteraceae | Silybum marianum  | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
Plantae | Combretaceae | Terminalia chebula  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Eruca vesicaria subsp. Sativa  | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
Plantae | Labiatae | Anisomeles indica  | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Triticum aestivum  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
|
|
zoom in
Organism | Terminalia chebula | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|