Name |
Maltose |
Formula |
C12H22O11 |
Mw |
342.11621155 |
CAS RN |
69-79-4 |
C_ID |
C00001140
,
|
InChIKey |
GUBGYTABKSRVRQ-NVKTZKGVNA-N |
InChICode |
InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4+,5+,6+,7-,8-,9-,10+,11-,12-/m1/s1 |
SMILES |
[C@H]1([C@@H]([C@H]([C@H](O[C@@H]1CO)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1CO)O)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caryophyllales | Beta vulgaris | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum L. | Ref. |
- | - | Caffea sp. | Ref. |
- | - | FOOD SAKE | Ref. |
|
|
zoom in
Organism | Panax ginseng | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
---|
|