Name |
Tangeretin 4',5,6,7,8-Pentamethoxyflavone |
Formula |
C20H20O7 |
Mw |
372.12090299 |
CAS RN |
481-53-8 |
C_ID |
C00001105
,
|
InChIKey |
ULSUXBXHSYSGDT-UHFFFAOYSA-N |
InChICode |
InChI=1S/C20H20O7/c1-22-12-8-6-11(7-9-12)14-10-13(21)15-16(23-2)18(24-3)20(26-5)19(25-4)17(15)27-14/h6-10H,1-5H3 |
SMILES |
COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Camaenidae | Mandarina satsuma | Ref. |
Fungi | Trichocomaceae | Aspergillus niger | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Asteraceae | Artemisia mesatlantica | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Lauraceae | Laurus nobilis L. | Ref. |
Plantae | Moraceae | Ficus beecheyana | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus deliciosa | Ref. |
Plantae | Rutaceae | Citrus grandis var.tomentosa | Ref. |
Plantae | Rutaceae | Citrus jambhiri Lush. | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus tangerina | Ref. |
Plantae | Rutaceae | Fortunella japonica | Ref. |
Plantae | Rutaceae | Fortunella margaria | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
- | - | Xinhui citrus | Ref. |
|
|
zoom in
Organism | Artemisia mesatlantica | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Ferreres,Agroquim.Tecnol.Aliment.,20,(1981),285
Holeman,Planta Med.,57,(1991),57 |
---|
|