Name |
Isovitexin 6-beta-D-Glucopyranosyl-4',5,7-trihydroxyflavone Homovitexin 6-C-beta-D-Glucopyranosylapigenin Saponaretin 6-beta-D-Glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
Formula |
C21H20O10 |
Mw |
432.10564686 |
CAS RN |
38953-85-4 |
C_ID |
C00001059
,
|
InChIKey |
MYXNWGACZJSMBT-XZIDVWOUNA-N |
InChICode |
InChI=1S/C21H20O10/c22-7-14-17(26)19(28)20(29)21(31-14)16-11(25)6-13-15(18(16)27)10(24)5-12(30-13)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21+/m1/s1 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
Plantae | Annonaceae | Hornschuchia citriodora | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Araceae | Colocasia esculenta | Ref. |
Plantae | Araceae | Colocasia escultenta | Ref. |
Plantae | Asphodelaceae | Aloe spp. | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
Plantae | Caryophyllaceae | Drymaria diandra | Ref. |
Plantae | Caryophyllaceae | Stellaria media | Ref. |
Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
Plantae | Chloranthaceae | Ascarina lucida | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hombroniana | Ref. |
Plantae | Commelinaceae | Commelina communis L | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis (L.) | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
Plantae | Euphorbiaceae | Cladogynos orientalis | Ref. |
Plantae | Euphorbiaceae | Macaranga tanarius | Ref. |
Plantae | Euphorbiaceae | Strophioblachia fimbricalyx Boerl | Ref. |
Plantae | Fabaceae | Acacia caven | Ref. |
Plantae | Fabaceae | Acacia furcatispina | Ref. |
Plantae | Fabaceae | Anadenanthera peregrina | Ref. |
Plantae | Fabaceae | Crotalaria micans | Ref. |
Plantae | Fabaceae | Crotalaria verrucosa | Ref. |
Plantae | Fabaceae | Cytisus hirsutus | Ref. |
Plantae | Fabaceae | Dalbergia monetaria | Ref. |
Plantae | Fabaceae | Desmodium triflorum | Ref. |
Plantae | Fabaceae | Galactia glaucophylla | Ref. |
Plantae | Fabaceae | Gleditsia japonica | Ref. |
Plantae | Fabaceae | Gleditsia sinensis | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Lespedeza capitata | Ref. |
Plantae | Fabaceae | Lespedeza hedysaroides | Ref. |
Plantae | Fabaceae | Lespedeza juncea | Ref. |
Plantae | Fabaceae | Lupinus sericeus | Ref. |
Plantae | Fabaceae | Otholobium bracteolatum | Ref. |
Plantae | Fabaceae | Otholobium foliosum | Ref. |
Plantae | Fabaceae | Otholobium fruticans | Ref. |
Plantae | Fabaceae | Otholobium hirtum | Ref. |
Plantae | Fabaceae | Otholobium parviflorum | Ref. |
Plantae | Fabaceae | Otholobium sericeum | Ref. |
Plantae | Fabaceae | Parkinsonia aculeata | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Prosopis alba | Ref. |
Plantae | Fabaceae | Prosopis argentina | Ref. |
Plantae | Fabaceae | Prosopis chilensis | Ref. |
Plantae | Fabaceae | Prosopis fiebrigii | Ref. |
Plantae | Fabaceae | Prosopis hassleri | Ref. |
Plantae | Fabaceae | Prosopis kuntzei | Ref. |
Plantae | Fabaceae | Prosopis nigra | Ref. |
Plantae | Fabaceae | Prosopis reptans | Ref. |
Plantae | Fabaceae | Prosopis ruscifolia | Ref. |
Plantae | Fabaceae | Prosopis strombulifera | Ref. |
Plantae | Fabaceae | Prosopis vinalillo | Ref. |
Plantae | Fabaceae | Psophocarpus tetragonolobus | Ref. |
Plantae | Fabaceae | Psoralea affinis | Ref. |
Plantae | Fabaceae | Psoralea arborea | Ref. |
Plantae | Fabaceae | Psoralea asarina | Ref. |
Plantae | Fabaceae | Psoralea connixa | Ref. |
Plantae | Fabaceae | Psoralea effusa | Ref. |
Plantae | Fabaceae | Psoralea imbricata | Ref. |
Plantae | Fabaceae | Psoralea laxa | Ref. |
Plantae | Fabaceae | Psoralea papillosa | Ref. |
Plantae | Fabaceae | Psoralea ramulosa | Ref. |
Plantae | Fabaceae | Psoralea speciosa | Ref. |
Plantae | Fabaceae | Rhynchosia cana | Ref. |
Plantae | Fabaceae | Rhynchosia capitata | Ref. |
Plantae | Fabaceae | Rhynchosia heynei | Ref. |
Plantae | Fabaceae | Rhynchosia jacobii | Ref. |
Plantae | Fabaceae | Rhynchosia minima | Ref. |
Plantae | Fabaceae | Rhynchosia rothii | Ref. |
Plantae | Fabaceae | Rhynchosia suaveolens | Ref. |
Plantae | Fabaceae | Securigera varia | Ref. |
Plantae | Fabaceae | Tamarindus indica | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vigna mungo | Ref. |
Plantae | Fabaceae | Vigna radiata | Ref. |
Plantae | Gentianaceae | Gentiana algida | Ref. |
Plantae | Gentianaceae | Gentiana argentea | Ref. |
Plantae | Gentianaceae | Gentiana arisanensis | Ref. |
Plantae | Gentianaceae | Gentiana asclepiadea | Ref. |
Plantae | Gentianaceae | Gentiana crassicaulis | Ref. |
Plantae | Gentianaceae | Gentiana decumbens | Ref. |
Plantae | Gentianaceae | Gentiana decumbers | Ref. |
Plantae | Gentianaceae | Gentiana depressa | Ref. |
Plantae | Gentianaceae | Gentiana elwesii | Ref. |
Plantae | Gentianaceae | Gentiana lawrencei | Ref. |
Plantae | Gentianaceae | Gentiana lutea | Ref. |
Plantae | Gentianaceae | Gentiana macrophylla | Ref. |
Plantae | Gentianaceae | Gentiana officinalis | Ref. |
Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
Plantae | Gentianaceae | Gentiana prolata | Ref. |
Plantae | Gentianaceae | Gentiana rigescens | Ref. |
Plantae | Gentianaceae | Gentiana sikkimensis | Ref. |
Plantae | Gentianaceae | Gentiana straminea | Ref. |
Plantae | Gentianaceae | Gentiana triflora | Ref. |
Plantae | Gentianaceae | Swertia perennis | Ref. |
Plantae | Gentianaceae | Swertia pseudochinensis | Ref. |
Plantae | Gentianaceae | Swertia punicea | Ref. |
Plantae | Gentianaceae | Tripterospermum japonicum | Ref. |
Plantae | Geraniaceae | Geranium phaeum | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Labiatae | Vitex littoralis | Ref. |
Plantae | Labiatae | Vitex lucens | Ref. |
Plantae | Labiatae | Vitex polygama | Ref. |
Plantae | Linaceae | Linum usitatissimum | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Palmae | Phoenix hanceana var. formosana | Ref. |
Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
Plantae | Passifloraceae | Passiflora spp. | Ref. |
Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Polygonaceae | Polygonum affine | Ref. |
Plantae | Rubiaceae | Hedyotis dichotoma | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Smilacaceae | Smilax bracteata | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE | Ref. |
Plantae | Thymelaeaceae | Daphne sericea | Ref. |
|
|
zoom in
Organism | Trigonella foenum-graecum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|