Name |
Isoorientin Homoorientin Lespecapitioside Luteolin 6-C-beta-D-glucopyranoside 2-(3,4-Dihydroxyphenyl)-6-beta-D-glucopyranosyl-5,7-dihydroxy-4H-1-benzopyran-4-one |
Formula |
C21H20O11 |
Mw |
448.10056148 |
CAS RN |
4261-42-1 |
C_ID |
C00001055
,
|
InChIKey |
ODBRNZZJSYPIDI-XZIDVWOUNA-N |
InChICode |
InChI=1S/C21H20O11/c22-6-14-17(27)19(29)20(30)21(32-14)16-11(26)5-13-15(18(16)28)10(25)4-12(31-13)7-1-2-8(23)9(24)3-7/h1-5,14,17,19-24,26-30H,6H2/t14-,17-,19+,20-,21+/m1/s1 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1cc(c(cc1)O)O)O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Apiaceae | Astrantia major | Ref. |
Plantae | Araceae | Colocasia esculenta | Ref. |
Plantae | Araceae | Colocasia escultenta | Ref. |
Plantae | Asteraceae | Centaurea gigantea | Ref. |
Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
Plantae | Asteraceae | Centaurea solstitialis | Ref. |
Plantae | Asteraceae | Helenium spp. | Ref. |
Plantae | Caryophyllaceae | Melandrium album | Ref. |
Plantae | Caryophyllaceae | Stellaria holostea | Ref. |
Plantae | Caryophyllaceae | Stellaria nemorum | Ref. |
Plantae | Chloranthaceae | Ascarina lucida | Ref. |
Plantae | Commelinaceae | Commelina communis L | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Eriocaulaceae | Leiothrix flavescens | Ref. |
Plantae | Fabaceae | Abrus precatorius | Ref. |
Plantae | Fabaceae | Anadenanthera peregrina | Ref. |
Plantae | Fabaceae | Aspalathus acuminata | Ref. |
Plantae | Fabaceae | Crotalaria laburnifolia | Ref. |
Plantae | Fabaceae | Cytisus hirsutus | Ref. |
Plantae | Fabaceae | Eriosema montanum | Ref. |
Plantae | Fabaceae | Eriosema psoraleoides | Ref. |
Plantae | Fabaceae | Eriosema robustum | Ref. |
Plantae | Fabaceae | Galactia glaucophylla | Ref. |
Plantae | Fabaceae | Gleditsia japonica | Ref. |
Plantae | Fabaceae | Gleditsia sinensis | Ref. |
Plantae | Fabaceae | Kummerowia striata | Ref. |
Plantae | Fabaceae | Lespedeza bicolor | Ref. |
Plantae | Fabaceae | Lespedeza capitata | Ref. |
Plantae | Fabaceae | Lespedeza hedysaroides | Ref. |
Plantae | Fabaceae | Lespedeza juncea | Ref. |
Plantae | Fabaceae | Lupinus polyphyllus | Ref. |
Plantae | Fabaceae | Lupinus sericeus | Ref. |
Plantae | Fabaceae | Melilotus alba | Ref. |
Plantae | Fabaceae | Mucuna sempervirens | Ref. |
Plantae | Fabaceae | Otholobium bolusii | Ref. |
Plantae | Fabaceae | Otholobium bracteolatum | Ref. |
Plantae | Fabaceae | Otholobium candicans | Ref. |
Plantae | Fabaceae | Otholobium foliosum | Ref. |
Plantae | Fabaceae | Otholobium fruticans | Ref. |
Plantae | Fabaceae | Otholobium hirtum | Ref. |
Plantae | Fabaceae | Otholobium obliquum | Ref. |
Plantae | Fabaceae | Otholobium parviflorum | Ref. |
Plantae | Fabaceae | Otholobium sericeum | Ref. |
Plantae | Fabaceae | Otholobium stachyerum | Ref. |
Plantae | Fabaceae | Otholobium striatum | Ref. |
Plantae | Fabaceae | Otholobium uncinatum | Ref. |
Plantae | Fabaceae | Otholobium zeyheri | Ref. |
Plantae | Fabaceae | Parkinsonia aculeata | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Psoralea aculeata | Ref. |
Plantae | Fabaceae | Psoralea affinis | Ref. |
Plantae | Fabaceae | Psoralea arborea | Ref. |
Plantae | Fabaceae | Psoralea asarina | Ref. |
Plantae | Fabaceae | Psoralea axillaris | Ref. |
Plantae | Fabaceae | Psoralea connixa | Ref. |
Plantae | Fabaceae | Psoralea effusa | Ref. |
Plantae | Fabaceae | Psoralea exile | Ref. |
Plantae | Fabaceae | Psoralea fascicularis | Ref. |
Plantae | Fabaceae | Psoralea glabra | Ref. |
Plantae | Fabaceae | Psoralea imbricata | Ref. |
Plantae | Fabaceae | Psoralea laxa | Ref. |
Plantae | Fabaceae | Psoralea oligophylla | Ref. |
Plantae | Fabaceae | Psoralea oreopolum | Ref. |
Plantae | Fabaceae | Psoralea papillosa | Ref. |
Plantae | Fabaceae | Psoralea pinnata | Ref. |
Plantae | Fabaceae | Psoralea pullata | Ref. |
Plantae | Fabaceae | Psoralea ramulosa | Ref. |
Plantae | Fabaceae | Psoralea speciosa | Ref. |
Plantae | Fabaceae | Psoralea verrucosa | Ref. |
Plantae | Fabaceae | Rhynchosia beddomei | Ref. |
Plantae | Fabaceae | Rhynchosia cana | Ref. |
Plantae | Fabaceae | Rhynchosia capitata | Ref. |
Plantae | Fabaceae | Rhynchosia heynei | Ref. |
Plantae | Fabaceae | Rhynchosia minima | Ref. |
Plantae | Fabaceae | Rhynchosia rothii | Ref. |
Plantae | Fabaceae | Rhynchosia rufescens | Ref. |
Plantae | Fabaceae | Rhynchosia suaveolens | Ref. |
Plantae | Fabaceae | Securigera varia | Ref. |
Plantae | Fabaceae | Tamarindus indica | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Gentianaceae | Gentiana algida | Ref. |
Plantae | Gentianaceae | Gentiana asclepiadea | Ref. |
Plantae | Gentianaceae | Gentiana crassicaulis | Ref. |
Plantae | Gentianaceae | Gentiana cruciate | Ref. |
Plantae | Gentianaceae | Gentiana decumbens | Ref. |
Plantae | Gentianaceae | Gentiana decumbers | Ref. |
Plantae | Gentianaceae | Gentiana depressa | Ref. |
Plantae | Gentianaceae | Gentiana elwesii | Ref. |
Plantae | Gentianaceae | Gentiana gelida | Ref. |
Plantae | Gentianaceae | Gentiana lawrencei | Ref. |
Plantae | Gentianaceae | Gentiana loureirii | Ref. |
Plantae | Gentianaceae | Gentiana lutea | Ref. |
Plantae | Gentianaceae | Gentiana macrophylla | Ref. |
Plantae | Gentianaceae | Gentiana officinalis | Ref. |
Plantae | Gentianaceae | Gentiana olivieri | Ref. |
Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
Plantae | Gentianaceae | Gentiana prolata | Ref. |
Plantae | Gentianaceae | Gentiana rhodantha | Ref. |
Plantae | Gentianaceae | Gentiana rigescens | Ref. |
Plantae | Gentianaceae | Gentiana sikkimensis | Ref. |
Plantae | Gentianaceae | Gentiana spp. | Ref. |
Plantae | Gentianaceae | Gentiana straminea | Ref. |
Plantae | Gentianaceae | Gentiana triflora | Ref. |
Plantae | Gentianaceae | Swertia angustifolia | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Labiatae | Stachys scardica Griseb. | Ref. |
Plantae | Labiatae | Vitex cannabifolia Sieb.et.Zucc. | Ref. |
Plantae | Labiatae | Vitex polygama | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Oxalidaceae | Oxalis corniculata | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Palmae | Phoenix hanceana var. formosana | Ref. |
Plantae | Passifloraceae | Passiflora spp. | Ref. |
Plantae | Petrosaviaceae/Nartheciaceae | Japonolirion osense | Ref. |
Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Polygonum orientale | Ref. |
Plantae | Ranunculaceae | Adonis spp. | Ref. |
Plantae | Ranunculaceae | Ranunculus japonicus | Ref. |
Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Violaceae | Viola yedoensis | Ref. |
|
|
zoom in
Organism | Gentiana asclepiadea | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|