Name |
5,4'-Dihydroxy-7-methoxyflavone Genkwanin |
Formula |
C16H12O5 |
Mw |
284.06847349 |
CAS RN |
437-64-9 |
C_ID |
C00001043
,
|
InChIKey |
JPMYFOBNRRGFNO-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ageratina pichinchensis | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Fabaceae | Acacia constricta | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Medicago polymorpha | Ref. |
Plantae | Fabaceae | Mimosa hostilis | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Hydrocharitaceae | Halophila stipulacea | Ref. |
Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton | Ref. |
Plantae | Labiatae | Ocimum basilicum L. | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicum L. | Ref. |
Plantae | Labiatae | Ocimum selloi Benth. | Ref. |
Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
Plantae | Labiatae | Origanum akhadarense | Ref. |
Plantae | Labiatae | Origanum boissieri | Ref. |
Plantae | Labiatae | Origanum calcaratum | Ref. |
Plantae | Labiatae | Origanum dictamnus | Ref. |
Plantae | Labiatae | Origanum floribundum | Ref. |
Plantae | Labiatae | Origanum hypercifolium | Ref. |
Plantae | Labiatae | Origanum intercedens | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum micranthum | Ref. |
Plantae | Labiatae | Origanum microphyllum | Ref. |
Plantae | Labiatae | Origanum onites | Ref. |
Plantae | Labiatae | Origanum syriacum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Glandulosum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Hirtum | Ref. |
Plantae | Labiatae | Plectranthus fruticosus | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia dorrii | Ref. |
Plantae | Labiatae | Salvia glutinosa | Ref. |
Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
Plantae | Labiatae | Salvia lavandulifolia | Ref. |
Plantae | Labiatae | Salvia microsiphon | Ref. |
Plantae | Labiatae | Salvia nicolsoniana | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia palaestina | Ref. |
Plantae | Labiatae | Salvia sapinae | Ref. |
Plantae | Labiatae | Salvia stenophylla | Ref. |
Plantae | Labiatae | Salvia yosgadensis | Ref. |
Plantae | Labiatae | Teucrium ramosissimum | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Menispermaceae | Tinospora crispa | Ref. |
Plantae | Pteridaceae | Cheilanthes albomarginata | Ref. |
Plantae | Pteridaceae | Cheilanthes rufa | Ref. |
Plantae | Thymelaeaceae | Daphne genkwa | Ref. |
Plantae | Zygophyllaceae | Larrea divaricata | Ref. |
Plantae | Zygophyllaceae | Larrea tridentata | Ref. |
- | - | Syphopappus polystachyus | Ref. |
|
|
zoom in
Organism | Origanum syriacum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|