Name |
Chrysoeriol Luteolin 3'-methyl ether |
Formula |
C16H12O6 |
Mw |
300.06338812 |
CAS RN |
491-71-4 |
C_ID |
C00001029
,
|
InChIKey |
SCZVLDHREVKTSH-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-7,17-19H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1cc(c(cc1)O)OC)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
Plantae | Asteraceae | Onopordum acanthium | Ref. |
Plantae | Asteraceae | Tanacetum parthenium (L.) Schulz Bip. | Ref. |
Plantae | Asteraceae | Tanacetum vulgare L. | Ref. |
Plantae | Bignoniaceae | Newbouldia laevis | Ref. |
Plantae | Cannabaceae | Cannabis indica | Ref. |
Plantae | Cannabaceae | Cannabis sativa L. | Ref. |
Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Bauhinia guianensis | Ref. |
Plantae | Fabaceae | Cadia purpurea | Ref. |
Plantae | Fabaceae | Cassia alata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Hymenaea palustris Ducke | Ref. |
Plantae | Fabaceae | Lotus maritimus | Ref. |
Plantae | Fabaceae | Medicago intertexta | Ref. |
Plantae | Fabaceae | Medicago marina | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Parkinsonia aculeata | Ref. |
Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
Plantae | Fabaceae | Thermopsis alterniflora | Ref. |
Plantae | Fabaceae | Thermopsis macrophylla | Ref. |
Plantae | Fabaceae | Thermopsis mollis | Ref. |
Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
Plantae | Fabaceae | Thermopsis villosa | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hydrocharitaceae | Halophila stipulacea | Ref. |
Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon glutinosum | Ref. |
Plantae | Labiatae | Leucas aspera | Ref. |
Plantae | Labiatae | Marrubium velutinum | Ref. |
Plantae | Labiatae | Origanum majoricum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Salvia candidissima | Ref. |
Plantae | Labiatae | Salvia dorrii | Ref. |
Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
Plantae | Labiatae | Salvia mirzayana | Ref. |
Plantae | Labiatae | Salvia palaestina | Ref. |
Plantae | Lamiaceae | Coleus amboinicus | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Myoporaceae | Myoporum bontioides | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
Plantae | Plantaginaceae | Veronica hederifolia | Ref. |
Plantae | Plantaginaceae | Veronica triloba | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Zea mays L. | Ref. |
Plantae | Pteridaceae | Notholaena californica | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Salicaceae | Salix babylonica | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Turneraceae | Turnera diffusa | Ref. |
Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
Plantae | Zygophyllaceae | Larrea divaricata | Ref. |
Plantae | Zygophyllaceae | Larrea tridentata | Ref. |
- | - | Echinop ritro | Ref. |
- | - | Riella affinis | Ref. |
- | - | Riella americana | Ref. |
|
|
zoom in
Organism | Turnera diffusa | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|