Name |
Baicalein Noroxylin 5,6,7-Trihydroxyflavone |
Formula |
C15H10O5 |
Mw |
270.05282343 |
CAS RN |
491-67-8 |
C_ID |
C00001022
,
|
InChIKey |
FXNFHKRTJBSTCS-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O5/c16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12/h1-7,17-19H |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccccc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Bignoniaceae | Oroxylum indicum | Ref. |
Plantae | Cactaceae | Austrocylindropuntia subulata | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Scutellaria lateriflora | Ref. |
Plantae | Labiatae | Scutellaria oreophila | Ref. |
Plantae | Labiatae | Scutellaria spp. | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
|
|
zoom in
Organism | Trifolium pratense | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|