Name |
Apigenin 7-O-beta-D-glucopyranoside Cosmosiin Apigenin 7-glucoside (-)-Apigenin 7-glucoside Apigenin-7-O-beta-D-glucopyranoside 7-O-beta-D-glucopyranosylapigenin Apigenin-7-O-glucoside Apigenin 7-O-beta-glucopyranoside Cosmoside |
Formula |
C21H20O10 |
Mw |
432.10564686 |
CAS RN |
578-74-5 |
C_ID |
C00001017
,
|
InChIKey |
KMOUJOKENFFTPU-OHPGNTIMNA-N |
InChICode |
InChI=1S/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Asystasia gangetica L. | Ref. |
Plantae | Annonaceae | Hornschuchia citriodora | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asphodelaceae | Aloe barbadensis | Ref. |
Plantae | Asphodelaceae | Aloe sabaea | Ref. |
Plantae | Asphodelaceae | Aloe saponaria | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
Plantae | Asteraceae | Achillea atrata L.ssp.multifida | Ref. |
Plantae | Asteraceae | Bellis perennis | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Chamomilla recutita (L.) Rauschert | Ref. |
Plantae | Asteraceae | Chrysanthemum indicum | Ref. |
Plantae | Asteraceae | Cosmos bipinnatus | Ref. |
Plantae | Asteraceae | Cynara scolymus | Ref. |
Plantae | Asteraceae | Helichrysum graveolen | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Santolina chamaecyperissus | Ref. |
Plantae | Asteraceae | Saussurea medusa | Ref. |
Plantae | Asteraceae | Zinnia elegans | Ref. |
Plantae | Boraginaceae | Onosma hispida | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis clematidea | Ref. |
Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
Plantae | Crassulaceae | Rhodiola rosea | Ref. |
Plantae | Crassulaceae | Sedum sarmentosum | Ref. |
Plantae | Ephedraceae | Ephedra campylopoda | Ref. |
Plantae | Euphorbiaceae | Euphorbia prostrata | Ref. |
Plantae | Euphorbiaceae | Strophioblachia fimbricalyx Boerl | Ref. |
Plantae | Fabaceae | Cadia purpurea | Ref. |
Plantae | Fabaceae | Lupinus albus L. | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Retama raetam | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Gentianaceae | Gentiana loureirii | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Haemodoraceae | Anigozanthos pulcherrimus | Ref. |
Plantae | Haemodoraceae | Anigozanthos rufus | Ref. |
Plantae | Haemodoraceae | Xiphidium caeruleum | Ref. |
Plantae | Iridaceae | Crocus chrysanthus-biflorus | Ref. |
Plantae | Labiatae | Ballota foetida | Ref. |
Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
Plantae | Labiatae | Ocimum sanctum | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Phlomis nissolii | Ref. |
Plantae | Labiatae | Prostanthera melissifolia | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia aegypteacae | Ref. |
Plantae | Labiatae | Salvia aegyptiaca | Ref. |
Plantae | Labiatae | Salvia albimaculata | Ref. |
Plantae | Labiatae | Salvia calycina | Ref. |
Plantae | Labiatae | Salvia horminum | Ref. |
Plantae | Labiatae | Salvia lanigera | Ref. |
Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
Plantae | Labiatae | Salvia limbata | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia palaestina | Ref. |
Plantae | Labiatae | Salvia pinnata | Ref. |
Plantae | Labiatae | Salvia pratensis | Ref. |
Plantae | Labiatae | Salvia spinosa | Ref. |
Plantae | Labiatae | Salvia triloba | Ref. |
Plantae | Labiatae | Stachys germanica L. | Ref. |
Plantae | Labiatae | Stachys lanata | Ref. |
Plantae | Labiatae | Stachys plumosa Griseb. | Ref. |
Plantae | Labiatae | Thymus numidicus | Ref. |
Plantae | Linderniaceae | Torenia fournieri | Ref. |
Plantae | Lythraceae | Lawsonia alba | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Moraceae | Broussonetia papyrifera | Ref. |
Plantae | Oleaceae | Ligustrum robustum | Ref. |
Plantae | Oxalidaceae | Oxalis corniculata | Ref. |
Plantae | Plantaginaceae | Plantago argentea | Ref. |
Plantae | Plantaginaceae | Plantago holosteum | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Plantaginaceae | Plantago maritima | Ref. |
Plantae | Plantaginaceae | Veronica montana | Ref. |
Plantae | Plantaginaceae | Veronica polita | Ref. |
Plantae | Plantaginaceae | Veronica spuria | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Pteridaceae | Pteris multifida | Ref. |
Plantae | Rosaceae | Physocarpus capitatus | Ref. |
Plantae | Salicaceae | Salix viminalis L. | Ref. |
Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
Plantae | Scrophulariaceae | Leucophyllum ambiguum | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
- | - | Riella affinis | Ref. |
- | - | Riella americana | Ref. |
|
|
zoom in
Organism | Veronica polita | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|