Name |
5-Hydroxy-7,4'-dimethoxyflavone Apigenin 7,4'-dimethyl ether 5-Hydroxy-4',7-dimethoxyflavone Genkwanin 4'-methyl ether 7-O-Methylacacetin Acacetin 7-methyl ether 5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one 4'-Methoxytectochrysin |
Formula |
C17H14O5 |
Mw |
298.08412356 |
CAS RN |
5128-44-9 |
C_ID |
C00001016
,
|
InChIKey |
LZERJKGWTQYMBB-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O5/c1-20-11-5-3-10(4-6-11)15-9-14(19)17-13(18)7-12(21-2)8-16(17)22-15/h3-9,18H,1-2H3 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(cc1)OC)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Andrographis paniculata | Ref. |
Plantae | Anacardiaceae | Rhus undulata | Ref. |
Plantae | Annonaceae | Artabotrys uncinatus | Ref. |
Plantae | Asteraceae | Artemisia afra | Ref. |
Plantae | Asteraceae | Artemisia diffusa | Ref. |
Plantae | Asteraceae | Baccharis crispa | Ref. |
Plantae | Asteraceae | Baccharis rhomboidalis | Ref. |
Plantae | Asteraceae | Baccharis trinervis | Ref. |
Plantae | Asteraceae | Calea ternifolia | Ref. |
Plantae | Asteraceae | Hieracium amplexicaule | Ref. |
Plantae | Betulaceae | Alnus japonica | Ref. |
Plantae | Betulaceae | Betula nigra | Ref. |
Plantae | Cistaceae | Cistus clusii | Ref. |
Plantae | Cistaceae | Cistus spp. | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cunoniaceae | Eucryphia spp. | Ref. |
Plantae | Escalloniaceae | Escallonia pulverulenta | Ref. |
Plantae | Labiatae | Cunila angustifolia | Ref. |
Plantae | Labiatae | Dorystoechas hastata | Ref. |
Plantae | Labiatae | Hyptis albida | Ref. |
Plantae | Labiatae | Isodon flavidus | Ref. |
Plantae | Labiatae | Leucas cephalotes SPRENG. | Ref. |
Plantae | Labiatae | Lycopus virginicus | Ref. |
Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton | Ref. |
Plantae | Labiatae | Ocimum basilicum L. | Ref. |
Plantae | Labiatae | Ocimum minimum L. | Ref. |
Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
Plantae | Labiatae | Perovskia spp. | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia dorrii | Ref. |
Plantae | Labiatae | Salvia hypoleuca | Ref. |
Plantae | Labiatae | Salvia lavandulifolia | Ref. |
Plantae | Labiatae | Salvia macrosiphon | Ref. |
Plantae | Labiatae | Salvia moorcroftiana | Ref. |
Plantae | Labiatae | Salvia nicolsoniana | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia palaestina | Ref. |
Plantae | Labiatae | Salvia sapinae | Ref. |
Plantae | Labiatae | Salvia sclarea | Ref. |
Plantae | Labiatae | Salvia spp. | Ref. |
Plantae | Labiatae | Salvia syriaca | Ref. |
Plantae | Labiatae | Salvia texana | Ref. |
Plantae | Labiatae | Salvia verbenaca | Ref. |
Plantae | Labiatae | Salvia yosgadensis | Ref. |
Plantae | Labiatae | Sideritis spp. | Ref. |
Plantae | Labiatae | Teucrium marum | Ref. |
Plantae | Labiatae | Teucrium polium | Ref. |
Plantae | Labiatae | Teucrium ramosissimum | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
Plantae | Lejeuneaceae | Marchesinia brachiata | Ref. |
Plantae | Lejeuneaceae | Trocholejeunea scandvicensis | Ref. |
Plantae | Monocleaceae | Monoclea gottschei | Ref. |
Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
Plantae | Orobanchaceae | Striga asiatica | Ref. |
Plantae | Passifloraceae | Passiflora foetida | Ref. |
Plantae | Piperaceae | Peperomia dindygulensis Miq. | Ref. |
Plantae | Piperaceae | Peperomia sui | Ref. |
Plantae | Piperaceae | Piper peepuloides | Ref. |
Plantae | Plantaginaceae | Anarrhinum forskahlii | Ref. |
Plantae | Plantaginaceae | Antirrhinum spp. | Ref. |
Plantae | Pteridaceae | Cheilanthes grisea | Ref. |
Plantae | Stilbaceae | Nuxia sphaerocephala | Ref. |
Plantae | Zingiberaceae | Kaempferia parviflora | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Currania robertiana | Ref. |
- | - | Ophyrosporus charrua | Ref. |
|
|
zoom in
Organism | Passiflora foetida | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harbone, Comparative Biochemisty of the Flavonoids,(1965),39, Academic Press
Silva,Phytochem.,10,(1971),1942 |
---|
|