Name |
Phloridzin Phloretin 2'-glucoside Phlorizin |
Formula |
C21H24O10 |
Mw |
436.13694699 |
CAS RN |
60-81-1 |
C_ID |
C00000990
,
|
InChIKey |
IOUVKUPGCMBWBT-OHPGNTIMNA-N |
InChICode |
InChI=1S/C21H24O10/c22-9-16-18(27)19(28)20(29)21(31-16)30-15-8-12(24)7-14(26)17(15)13(25)6-3-10-1-4-11(23)5-2-10/h1-2,4-5,7-8,16,18-24,26-29H,3,6,9H2/t16-,18+,19-,20-,21+/m0/s1 |
SMILES |
c1(cc(c(c(c1)O)C(=O)CCc1ccc(cc1)O)O[C@@H]1O[C@H]([C@H]([C@@H]([C@@H]1O)O)O)CO)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Ericaceae | Kalmia latifolia | Ref. |
Plantae | Ericaceae | Loiseleuria procumbens (L.) Desv. | Ref. |
Plantae | Ericaceae | Pieris japonica | Ref. |
Plantae | Ericaceae | Rhododendron spp. | Ref. |
Plantae | Fabaceae | Flemingia strobilifera | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fagaceae | Lithocarpus liseifolius | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Oxalidaceae | Oxalis corniculata | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rosaceae | Malus domestica | Ref. |
Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
Plantae | Rosaceae | Malus spp. | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Pyrus communis | Ref. |
Plantae | Sapindaceae | Litchi chinensis | Ref. |
Plantae | Saxifragaceae | Lithophragma affine | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Symplocaceae | Symplocos lancifolia | Ref. |
Plantae | Symplocaceae | Symplocos spicata | Ref. |
|
|
zoom in
Organism | Lithophragma affine | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Williams,Nature,202,(1964),824 |
---|
|